Vinegar |
(Also known as: Acetic acid) |
Vinegar is a dilute form of ethanoic acid (acetic acid). It is used in food for flavoring but also has multiple applications as a pesticide. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Low alert
 |
|
Vinegar contains up to 10% acetic acid in water and has multiple pesticide applications |
|
Pathogen transference via tools & equipment; General weeds in non-agricultural areas; Fungal infections including Commo bunt, Barley leaf stripe, Alternaria, Fire blight, canker |
|
Cereal seeds; Market vegetable; Ornamentals; Non-cropped areas such as paths, terraces, borders |
|
- |
|
Current |
|
- |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
- |
|
Open ended |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
|
None |
|
C₂H₄O₂ |
|
CC(=O)O |
|
- |
|
QTBSBXVTEAMEQO-UHFFFAOYSA-N |
|
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
|
Yes |
|
Bactericide, Fungicide seed treatrment, Herbicide, Disinfectant |
|
Unclassified pesticide |
|
Food grade containing <=10% acetic acid |
|
- |
|
Synthetic |
|
- |
|
90132-02-8 |
|
64-19-7 |
|
290-419-7 |
|
- |
|
044001 |
|
176 |
|
No data found |
|
60.05 |
|
Ethanoic acid |
|
Ethanoic acid |
|
Ethanoic acid |
|
Approved via EU & UK 'Basic substance' legislation (Article 28 of Regulation (EC) No 1107/2009) |
|
EU dossier none declared- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
None |
|
Colourless lqiuid with sharp odour |
|
|
|
|
|
|
|
100000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
>200000 |
Toluene |
- |
>200000 |
Isopropanol |
- |
>200000 |
Ethyl acetate |
- |
>200000 |
Acetone |
- |
|
16.7 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
118.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.70 X 1001 |
Calculated |
- |
|
1.23 X 1000 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.96 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
1.2 |
as acetic acid |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
3350 |
Rat as acetic acid |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
45.0 |
Oncorhynchus mykiss as acetic acid |
Moderate |
|
- |
- |
- |
|
31.5 |
Daphnia magna as acetic acid |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
16.0 |
Lemna gibba as acetic acid |
Low |
|
5.8 |
Pseudokirchneriella subcapitata as biomass acetic acid |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
- |
- |
- |
|
3350 |
Rat as acetic acid |
Low |
|
1060 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Rabbit as acetic acid |
- |
|
- |
- |
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Minimal risks |
|
Minimal risks |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
XNo, known not to cause a problem |
|
|
|
Vinegar contains acetic acid and so has a corrosive nature |
|
|
|
Corrosive Emits irritating fumes when heated to decompositio Flammable IMDGTransport Hazard Class 8 |
|
Health: none allocated Environment: none allocated |
|
- |
|
UN2790 |
|
Packaging Group III (minor risk) |
|
- |
|
|
|
vinegar |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |