Triflusulfuron |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Drainflow: Mobile
 |
Ecotoxicity Low alert: Birds acute ecotoxicity: Low; Fish acute ecotoxicity: Low; Daphnia acute ecotoxicity: Low; Bees acute contact ecotoxicity: Low; Earthworms acute ecotoxicity: Low
 |
Human health Moderate alert: Possible Carcinogen
 |
|
A post-emergence herbicide for the control many annual and perennial broad-leaved weeds, normally used as the methyl variant |
|
Black bindweed; Charlock; Chickweed; Cleavers; Fathen; Field pansy; Fools parsley, Knotgrass; Redshank; Volunteer rape |
|
Sugarbeet; Fodder beet; Mangolds |
|
- |
|
Current |
|
- |
|
Approved |
|
31/12/2028 |
|
Check label - may vary with formulation |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
France/Denmark |
|
31/12/2023 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
|
|
✓ |
✓ |
✓ |
|
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
✓ |
✓ |
|
✓ |
✓ |
|
✓ |
|
|
|
|
None |
|
C₁₆H₁₇F₃N₆O₆S |
|
CC1=CC=CC(=C1S(=O)(=O)NC(=O)NC2=NC(=NC(=N2)OCC(F)(F)F)N(C)C)C(=O)O |
|
- |
|
AKTQJCBOGPBERP-UHFFFAOYSA-N |
|
InChI=1S/C16H17F3N6O6S/c1-8-5-4-6-9(11(26)27)10(8)32(29,30)24-14(28)21-12-20-13(25(2)3)23-15(22-12)31-7-16(17,18)19/h4-6H,7H2,1-3H3,(H,26,27)(H2,20,21,22,23,24,28) |
|
Yes |
|
Herbicide |
|
Sulfonylurea herbicide; Triazinylsulfonylurea herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, inhibits amino acid sysnthesis. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
|
135990-29-3 |
|
No data found |
|
731 |
|
- |
|
86416 |
|
No data found |
|
478.41 |
|
2-({[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)-3-methylbenzoic acid |
|
2-[4-dimethylamino-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-ylcarbamoylsulfamoyl]-m-toluic acid |
|
2-(((((4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl)amino)carbonyl)amino)sulfonyl)-3-methylbenzoic acid |
|
- |
|
- |
|
B |
|
2 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
|
|
Normally formulated using the methyl variant. |
|
|
|
|
|
1.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low |
|
- |
- |
- |
|
161.5 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.26 X 1003 |
Calculated |
- |
|
3.1 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
4.4 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
Weak acid |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
6.5 |
|
Non-persistent |
|
6.5 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
EU dossier data as methyl variant |
|
|
- |
- |
- |
|
- |
|
|
1.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 0.04-3.33days, leaves of 5 plants/crops grown undercover |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
- |
|
Mobile |
|
60 |
|
- |
|
Data as methyl variant |
|
- |
|
|
|
|
|
1.81 |
Calculated |
Transition state |
|
|
8.80 X 10-03 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2250 |
Colinus virginianus as methyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Eisenia foetida as methyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
|
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
730 |
Oncorhynchus mykiss as methyl variant |
Low |
|
- |
- |
- |
|
960 |
Daphnia magna as methyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.04 |
|
- |
|
1.2 |
|
- |
|
- |
- |
- |
|
0.04 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
May affect body weight and food intake Possible liver toxicant |
|
|
|
No information available |
|
Health: H351 Environment: H400, H410 |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
triflusulfuron |
|
triflusulfuron |
|
Triflusulfuron |
|
triflusulfuron |
|
triflusulfuron |
|
triflusulfuron |
|
- |
|
triflusulfuron |
|
triflusulfuron |
|
triszulfuron |
|
- |
|
- |