Triapenthenol (Ref: NTN 811) |
(Also known as: triazethanol; triazethan) |
Triapenthenol is a herbicide. It is highly soluble in water. Little is known regarding its environmental fate but it is considered to be persistent in soils. It is not highly toxic to mammals. It shows a high level of toxicity to birds. There is little information on its toxicity to biodiversity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
Human health Low alert
 Warning: Significant data are missing |
|
A plant growth regulator that acts mainly by the inhibition of shoot growth |
|
Growth |
|
Ornamentals |
|
- |
|
Current |
|
1984, first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Triapenthenol is a chiral molecule existing in the S- and R-forms. The technical material is an isomeric mixture. |
|
C₁₅H₂₅N₃O |
|
CC(C)(C)C(C(=CC1CCCCC1)N2C=NC=N2)O |
|
CC(C)(C)C(/C(=C\C1CCCCC1)/N2C=NC=N2)O |
|
CNFMJLVJDNGPHR-UKTHLTGXSA-N |
|
InChI=1S/C15H25N3O/c1-15(2,3)14(19)13(18-11-16-10-17-18)9-12-7-5-4-6-8-12/h9-12,14,19H,4-8H2,1-3H3/b13-9+ |
|
Yes |
|
Plant Growth Regulator, Herbicide, Safener |
|
Unclassified pesticide |
|
- |
|
- |
|
Synthetic |
|
Growth retardant effects caused by interfering with gibberellin biosynthesis |
|
76608-88-3 |
|
278-498-6 |
|
545 |
|
- |
|
6437842 |
|
No data found |
|
263.38 |
|
rac-(1E,3R)-1-cyclohexyl-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol |
|
(E)-(RS)-1-cyclohexyl-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol |
|
(βE)-β-(cyclohexylmethylene)-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol |
|
- |
|
- |
|
Not known |
|
Not known |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless crystalline solid |
|
|
|
|
|
|
|
Often applied as a soil drench |
|
|
|
|
|
68.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
200000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Dichloromethane |
- |
5000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source n-Hexane |
- |
10000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source 2-Propanol |
- |
2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Toluene |
- |
|
135.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.50 X 1002 |
Calculated |
- |
|
2.74 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
0.0044 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
81 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature DT₅₀ range 65-95 days (R3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
5000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
0.3 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
None allocated at this time |
|
Not classified: Obsolete |
|
- |
|
- |
|
- |
|
|
|
triapenthenol |
|
alpha-tert-butyl-(E)-beta-(cyclohexylméthylène)-1H-1,2,4-triazole-1-éthanol |
|
alpha-tert-Butyl-(E)-beta-(cyclohexylmethylen)-1H-1,2,4-triazol-1-ethanol |
|
- |
|
- |
|
alpha-terc-butil-(E)-beta-(ciclohexilmetilen)-1H-1,2,4-triazol-1-etanol |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |