Tolfenpyrad (Ref: OMI 88) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 |
Human health Moderate alert: Mammals acute toxicity: Moderate
 |
|
An insecticide mainly for high-value market crops. Also shows some fungidal activity against powdery mildew. |
|
Aphids; Leaf hoppers; Scale; Thrips; Whitefly; Potato psyllid; Colorado beetle |
|
Vegetables particularly cruciferous leafy varieties; Tea; Fruit; Indoor ornamentals except cut flowers |
|
- |
|
Current |
|
2002, Japan |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Japan; Dominican Republic; Thailand; Taiwan |
|
None |
|
C₂₁H₂₂ClN₃O₂ |
|
CCC1=NN(C(=C1Cl)C(=O)NCC2=CC=C(C=C2)OC3=CC=C(C=C3)C)C |
|
- |
|
WPALTCMYPARVNV-UHFFFAOYSA-N |
|
InChI=1S/C21H22ClN3O2/c1-4-18-19(22)20(25(3)24-18)21(26)23-13-15-7-11-17(12-8-15)27-16-9-5-14(2)6-10-16/h5-12H,4,13H2,1-3H3,(H,23,26) |
|
Yes |
|
Insecticide, Fungicide |
|
Pyrazole insecticide; Carboxamide insecticide; Pyrazolecarboxamide fungicide |
|
- |
|
- |
|
Synthetic |
|
Broad spectrum, contact activity, exhibits antifeedant activity especially against Lepidoptera. Mitochondrial complex I electron transport inhibitor. |
|
129558-76-5 |
|
603-342-4 |
|
- |
|
090111 |
|
10110536 |
|
No data found |
|
383.88 |
|
4-chloro-3-ethyl-1-methyl-N-{[4-(4-methylphenoxy)phenyl]methyl}-1H-pyrazole-5-carboxamide |
|
4-chloro-3-ethyl-1-methyl-N-[4-(p-tolyloxy)benzyl]pyrazole-5-carboxamide |
|
4-chloro-3-ethyl-1-methyl-N-[[4-(4-methylphenoxy)phenyl]methyl]-1H-pyrazole-5-carboxamide |
|
PAN listed Highly Hazardous Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
21A |
|
39 |
|
- |
|
White powder |
|
|
|
- Mitsubishi Chemical Corp.
- Nihon Nohyaku co Ltd
|
|
- Tolfenpyrad EC
- Nichino
- Torac
|
|
- |
|
|
|
|
|
0.087 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source at 25 °C |
Low |
|
7410 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source n-Hexane at 25 °C |
- |
366000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Toluene at 25 °C |
- |
59600 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Methanol at 25 °C |
- |
|
87.8 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
4.07 X 1005 |
Calculated |
- |
|
5.61 |
E4 E = Manufacturers safety data sheets 4 = Verified data at 25 °C |
High |
|
|
Insoluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.18 |
E4 E = Manufacturers safety data sheets 4 = Verified data at 25 °C |
- |
|
- |
- |
- |
- |
|
5.0 X 10-04 |
E4 E = Manufacturers safety data sheets 4 = Verified data at 25 °C |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
4 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature states DT₅₀ 3-5 days aerobic and 127-179 days anaerobic |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-mobile |
|
63300 |
|
Koc range 15100-149000 mL g⁻¹ |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-0.48 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
|
|
|
|
|
- |
- |
- |
|
Minor fraction |
0.046 |
- |
|
Major fraction |
0.158 |
- |
Known groundwater metabolites |
|
None
|
|
|
|
|
4-chloro-3-(1-hydroxyethyl)-1-methylpyrazole-5-carboxamide |
OH-PAM |
Plant |
- |
- |
4-[4-[[4-chloro-3-(1-hydroxyethyl)-1-methylpyrazol-5-yl]carbonylaminomehtyl]phenoxy] benzoic acid |
OH-PT-CA |
Rat |
- |
- |
4-chloro-3-(1-hydroxyethyl)-N-[4-[4-(hydroxymethyl)phenoxy]benzyl]-1-methylpyrazole-5-carboxamide |
OH-PT-OH |
Plant |
- |
- |
4-[4-(hydroxymethyl)phenoxy]benzoic acid |
OH-T-CA |
Plant |
- |
- |
4-[4-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)carbonylaminomethyl]phenoxy]benzoic acid |
PT-CA |
Rat |
- |
- |
Glucuronic acid conjugate of PT-CA |
PT-CA-GA |
Rat |
- |
- |
4-[4-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)carbonylaminomethyl]phenoxy]benzoic methyl ester |
PT-CA-Me |
Animal (Milk) |
- |
- |
2-[4-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)carbonylaminomethyl]phenoxy]phenylcarbonylamino]ethane-1-sulfonic acid |
PT-CA-TA |
Rat |
- |
- |
4-chloro-3-ethyl-N-[4-(4-formylphenoxy)benzyl]-1-methylpyrazole-5-carboxamide |
PT-CHO |
Surface water |
- |
- |
4-chloro-3-ethyl-N-[4-[4-(hydroxymethyl)phenoxy]benzyl]-1-methylpyrazole-5-carboxamide |
PT-OH |
Plant |
- |
- |
4-(p-tolyloxy)benzamide |
T-AM |
Plant |
- |
- |
4-(p-tolyloxy)benzoic acid |
T-CA |
Rat |
- |
- |
4-[4-[[4-chloro-1-methyl-3-(1-sulfoxyethyl)pyrazole-5-yl]]]carbonylaminomethyl]phenoxy]benzoic acid |
Sul-OH-PT-CA |
Rat |
- |
- |
4-[4-(aminomethyl)phenoxy]benzoic acid |
CA-T-NH2 |
Surface water |
- |
- |
4-chloro-(1-hydroxyethyl)-1-methyl-N-[4-(p-tolyloxy)benzyl]pyrazole-5-carboxamide |
OH-PT |
Plant |
- |
- |
bis[4-(hydroxymethyl)phenyl]ether |
OH-T-OH |
Plant |
- |
- |
4-chloro-3-ethyl-1-methylpyrazole-5-carboxylic acid |
PCA |
Plant |
- |
- |
4-[4-[(3-acetyl-4-chloro-1-methylpyrazol-5-yl)carbonylaminomethyl]phenoxy]benzoic acid |
CO-PT-CA |
Rat |
- |
- |
3-acetyl-4-chloro-1-methyl-???? |
CO-PT |
Plant; Rat |
- |
- |
4-chloro-3-ethyl-N-[4-(p-tolyloxy)benzyl]pyrazole-5-carboxamide |
DM-PT |
Plant |
- |
- |
4-(4-carbamoylphenoxy)benzoic acid |
CA-T-AM |
Plant |
- |
- |
4,4’-oxydibenzoic acid |
CA-T-CA |
Plant |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
386 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
83.0 |
E4 E = Manufacturers safety data sheets 4 = Verified data Colinus virginianus |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Harmful |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Aphidius colemani |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.049 |
E4 E = Manufacturers safety data sheets 4 = Verified data Cyprinus carpio |
High |
|
- |
- |
- |
|
0.008 |
E4 E = Manufacturers safety data sheets 4 = Verified data Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
1.36 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Unknown species |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
386 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Moderate |
|
2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
> 2.21 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Possible liver toxicant |
|
|
|
IMDG Tranport Hazard Class 9 |
|
None allocated at this time |
|
Not listed |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
tolfenpyrad |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |