Thidiazuron (Ref: SN 49537) |
(Also known as: TDZ) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate
 |
Human health Moderate alert: Neurotoxicant
 |
|
A herbicide and defoliant plant growth regulator which stimulates ethylene production in some crops particularly cotton |
|
Development of juvenille growth and regrowth; Vegetative growth |
|
Cotton; Mung beans; Melon |
|
- |
|
Current |
|
1982, USA |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₉H₈N₄OS |
|
C1=CC=C(C=C1)NC(=O)NC2=CN=NS2 |
|
- |
|
HFCYZXMHUIHAQI-UHFFFAOYSA-N |
|
InChI=1S/C9H8N4OS/c14-9(12-8-6-10-13-15-8)11-7-4-2-1-3-5-7/h1-6H,(H2,11,12,14) |
|
Yes |
|
Plant Growth Regulator, Herbicide, Other substance |
|
Disinfectant, Defoliant |
|
Phenylurea herbicide; Urea herbicide; Thiadiazolylurea herbicide |
|
>=95% |
|
- |
|
Synthetic |
|
Absorbed by leaves. A cytokine-active growth regulator. Inhibits the transmission of auxin and acts on plant cells that promote plant growth. |
|
51707-55-2 |
|
257-356-7 |
|
727 |
|
120301 |
|
40087 |
|
No data found |
|
220.25 |
|
N-phenyl-N'-1,2,3-thiadiazol-5-ylurea |
|
1-phenyl-3-(1,2,3-thiadiazol-5-yl)urea |
|
N-phenyl-N'-1,2,3-thiadiazol-5-ylurea |
|
- |
|
- |
|
E |
|
14 |
|
Not applicable |
|
Not applicable |
|
- |
|
White to pale yellow powder |
|
|
|
- Aventis
- Bayer CropScience
- Nufarm Americas
- Kingtai Chemicals
- BOC Sciences
|
|
|
|
Usually supplied as wettable powders and emulsifiable concentrates. |
|
|
|
|
|
20 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
4200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
400 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
|
213 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.89 X 1001 |
Calculated |
- |
|
1.77 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.51 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
8.86 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
Weak acid |
|
3.00 X 10-06 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
3.30 X 10-08 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
85 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
10 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
|
2.5 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Cotton leaves, n=1 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
742 |
|
Other sources: 110 mL g⁻¹ (DW4) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.13 |
Calculated |
Low leachability |
|
|
1.55 X 10-02 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
6.2 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5350 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Low |
|
|
- |
Z2 Z = Kingtai Chemials website (click here ) 2 = Unverified data of unknown source Rat |
- |
|
> 200 |
- |
|
- |
- |
- |
|
> 16000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Phasianidae |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
105 |
|
Low |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 19 |
Oncorhynchus mykiss |
Moderate |
|
5.7 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas |
Moderate |
|
> 10 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
Moderate |
|
0.1 |
Daphnia magna LOEC |
Moderate |
|
2.8 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
24 |
Lemna gibba 7 day |
Low |
|
0.15 |
Pseudokirchneriella subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5350 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Low |
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
2.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
No further information available |
|
|
|
Incompatible with strong oxidizing agents |
|
Health: H312, H315, H319, H332, H335 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
Limited shelf-life. Store at 2-8 DegC |
|
|
|
thidiazuron |
|
thidiazuron |
|
Thidiazuron |
|
thidiazuron |
|
tidiazuron |
|
tidiazuron |
|
- |
|
tidiazuron |
|
- |
|
- |
|
- |
|
- |