Thiazopyr (Ref: MON 13200) |
(Also known as: RH 123652) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; GUS: High leachability
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High
 |
Human health High alert: Neurotoxicant
 |
|
A pre-emergence herbicide for annual grasses and some broad-leaved weeds |
|
Barnyardgrass; Nutsedge; Canarygrass; Groundsel; Foxtail; Junglerice; Ragweed; London rocket; Shepherd's purse; Wild mustard |
|
Maize; Peanuts; Soybeans; Alfalfa |
|
- |
|
Current |
|
1997, USA |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₆H₁₇F₅N₂O₂S |
|
CC(C)CC1=C(C(=NC(=C1C(=O)OC)C(F)F)C(F)(F)F)C2=NCCS2 |
|
- |
|
YIJZJEYQBAAWRJ-UHFFFAOYSA-N |
|
InChI=1S/C16H17F5N2O2S/c1-7(2)6-8-9(15(24)25-3)11(13(17)18)23-12(16(19,20)21)10(8)14-22-4-5-26-14/h7,13H,4-6H2,1-3H3 |
|
Yes |
|
Herbicide |
|
Pyridine herbicide |
|
- |
|
- |
|
Synthetic |
|
Inhibits cell division. Microtubule assembly inhibition. |
|
117718-60-2 |
|
601-493-0 |
|
- |
|
129100 |
|
91776 |
|
No data found |
|
396.38 |
|
methyl 2-(difluoromethyl)-5-(4,5-dihydro-1,3-thiazol-2-yl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
|
methyl 2-difluoromethyl-5-(4,5-dihydro-1,3-thiazol-2-yl)-4-isobutyl-6-trifluoromethylnicotinate |
|
methyl 2-(difluoromethyl)-5-(4,5-dihydro-2-thiazolyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-3-pyridinecarboxylate |
|
- |
|
- |
|
K1 |
|
3 |
|
Not applicable |
|
Not applicable |
|
- |
|
Light tan crystalline solid |
|
|
|
- Dow AgroSciences
- Rohm and Haas Company
- Monsanto
|
|
|
|
- |
|
|
|
|
|
2.29 |
|
Low |
|
287000 |
Methanol |
- |
30600 |
Hexane |
- |
|
77.3 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
7.76 X 1003 |
Calculated |
- |
|
3.89 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.37 |
|
- |
|
- |
- |
- |
- |
|
0.27 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
4.75 X 10-02 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
64 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
85 |
|
Moderately persistent |
|
274 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data, US EPA gives field DT₅₀ of 111-437 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
7.8 |
|
Moderately fast |
|
Data for pH5 |
|
|
Stable |
|
Stable |
|
Stable at all relevant pH's |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Moderately mobile |
|
400 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
3.41 |
Calculated |
High leachability |
|
|
5.93 X 10-01 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
|
|
|
|
|
- |
- |
Aerobic |
|
- |
- |
Aerobic |
|
- |
- |
Aerobic |
|
- |
- |
Aerobic |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
0.36 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
- |
- |
|
- |
- |
- |
|
1814 |
Colinus virginianus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
=> 100 |
|
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
3.4 |
Oncorhynchus mykiss |
Moderate |
|
0.092 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Pimephales promelas |
Moderate |
|
6.1 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
Moderate |
|
0.11 |
Daphnia magna |
Moderate |
|
1.5 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.035 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lemna gibba |
Moderate |
|
0.04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Rat |
Low |
|
5000 |
Rat |
- |
|
> 1.2 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Kidney, liver, thyroid and blood toxicant USEPA - some evidence to suggest possible human carcinogen |
|
|
|
No information available |
|
Not classified: Obsolete |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
thiazopyr |
|
thiazopyr |
|
Thiazopyr |
|
thiazopyr |
|
tiazopir |
|
tiazopir |
|
- |
|
tiazopyr |
|
- |
|
- |
|
- |
|
- |