Tetraniliprole |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; GUS: High leachability
 |
Ecotoxicity Moderate alert: Daphnia acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate
 Warning: Significant data are missing |
|
An insecticide for the control of various insect pests on certain fruit and nuts |
|
Lepidopteran, Dipteran and Coleopteran pests |
|
Nuts including almonds, macadamias; Pome and stone fruit |
|
- |
|
Novel |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Australia, Canada, USA, Zimbabwe, Korea and Cambodia |
|
None |
|
C₂₂H₁₆ClF₃N₁₀O₂ |
|
CC1=CC(=CC(=C1NC(=O)C2=CC(=NN2C3=C(C=CC=N3)Cl)CN4N=C(N=N4)C(F)(F)F)C(=O)NC)C#N |
|
- |
|
KNDVJPKNBVIKML-UHFFFAOYSA-N |
|
InChI=1S/C22H16ClF3N10O2/c1-11-6-12(9-27)7-14(19(37)28-2)17(11)30-20(38)16-8-13(10-35-33-21(31-34-35)22(24,25)26)32-36(16)18-15(23)4-3-5-29-18/h3-8H,10H2,1-2H3,(H,28,37)(H,30,38) |
|
Yes |
|
Insecticide |
|
Diamide insecticide; Pyrazole insecticide; Pyridylpyrazole insecticide |
|
- |
|
- |
|
Synthetic |
|
Acts by ingestion. It interferes with the ryanodine-sensitive calcium release channels which lead to loss of muscle control and subsequent insect immobility. Ryanodine receptor modulator. |
|
1229654-66-3 |
|
810-161-6 |
|
- |
|
- |
|
- |
|
No data found |
|
544.88 |
|
1-(3-chloropyridin-2-yl)-N-[4-cyano-2-methyl-6-(methylcarbamoyl)phenyl]-3-([5-(trifluoromethyl)-2H-tetrazol-2-yl]methyl)-1H-pyrazole-5-carboxamide |
|
1-(3-chloro-2-pyridyl)-4′-cyano-2′-methyl-6′-(methylcarbamoyl)-3-([5-(trifluoromethyl)-2H-tetrazol-2-yl]methyl)-1H-pyrazole-5-carboxanilide |
|
1-(3-chloro-2-pyridinyl)-N-[4-cyano-2-methyl-6-[(methylamino)carbonyl]phenyl]-3-[[5-(trifluoromethyl)-2H-tetrazol-2-yl]methyl]-1H-pyrazole-5-carboxamide |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
28 |
|
Not applicable |
|
None identified |
|
Beige, solid powder |
|
|
|
|
|
1.0 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low |
|
170 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Toluene |
- |
2900 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Methanol |
- |
6400 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Ethyl acetate |
- |
21800 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Acetone |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
3.98 X 1002 |
Calculated |
- |
|
2.6 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.52 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
9.1 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
- |
|
3.2 X 10-03 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low volatility |
|
1.7 X 10-03 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Non-volatile |
|
Neutral S=soln: 204nm=45774, 267nm=17237 Acidic soln: 204nm=47357, 267nm=17172 Basic soln: 204nm=38595, 267nm=15969, 316nm=9645 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
- |
- |
- |
|
|
|
|
|
Not readily biodegradable |
|
|
86 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Moderately persistent |
|
86 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Moderately persistent |
|
165 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
86 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Geometric mean |
- |
|
Australian dossier: Lab studies DT₅₀ range 28 to 171 days; Field studies DT₅₀ 25-433 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
58.0 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Moderately persistent |
|
265 days at pH 4; 1.27 days at pH 9 |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
ND |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Moderately mobile |
|
224 |
|
Koc range: 195 - 252 mL g⁻¹ |
|
|
5.9 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
- |
|
- |
|
Australian dossier: Kf range 1.2-10 mL g⁻¹ |
|
- |
|
|
|
|
|
3.66 |
Calculated |
High leachability |
|
|
8.22 X 10-01 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 200 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 541 |
E4 E = Manufacturers safety data sheets 4 = Verified data Oncorhynchus mykiss |
Low |
|
- |
- |
- |
|
> 0.382 |
E4 E = Manufacturers safety data sheets 4 = Verified data Daphnia magna |
Moderate |
|
- |
- |
- |
|
> 541.0 |
E4 E = Manufacturers safety data sheets 4 = Verified data Raphidocelis subcapitata |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 200 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
Moderate |
|
2000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
- |
|
> 4.5 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
No information available |
|
|
|
Not explosive or oxidising IMDG Transport Hazard Class 9 Not expected to autoignite; Not highly flammable |
|
- |
|
- |
|
UN3082 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
tetraniliprole |
|
tétraniliprole |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |