Tetradifon (Ref: ENT 23737) |
(Also known as: tedion; sulfone) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; GUS: High leachability
 |
Ecotoxicity Moderate alert: Daphnia acute ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate
 |
Human health Low alert
 |
|
An acaricide for use in horticultural crops to control a wide range of phytophagous mites |
|
Citrus spider mite; Red spider mite; Flat mites; yellow mite |
|
Apples; Pears; Peaches; Citrus; Ornamentals; Cotton; Tea |
|
- |
|
Current |
|
circa 1955 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₂H₆Cl₄O₂S |
|
C1=CC(=CC=C1S(=O)(=O)C2=CC(=C(C=C2Cl)Cl)Cl)Cl |
|
- |
|
MLGCXEBRWGEOQX-UHFFFAOYSA-N |
|
InChI=1S/C12H6Cl4O2S/c13-7-1-3-8(4-2-7)19(17,18)12-6-10(15)9(14)5-11(12)16/h1-6H |
|
Yes |
|
Acaricide, Insecticide |
|
Bridged diphenyl insecticide; Bridge diphenyl acaricide |
|
- |
|
- |
|
Synthetic |
|
Non-systemic with larvicidal and ovicidal activity. Acts by inhibiting oxidative phosphorylation. Inhibitor of mitochondrial ATP synthase. |
|
116-29-0 |
|
204-134-2 |
|
113 |
|
079202 |
|
8305 |
|
No data found |
|
356.06 |
|
1,2,4-trichloro-5-(4-chlorobenzene-1-sulfonyl)benzene |
|
4-chlorophenyl 2,4,5-trichlorophenyl sulfone |
|
1,2,4-trichloro-5-((4-chlorophenyl)sulfonyl)benzene |
|
OSPAR soc |
|
- |
|
Not applicable |
|
Not applicable |
|
12D |
|
Not applicable |
|
Panonychus citri, Panonychus ulmi, Tetranychus mcdanieli, Tetranychus urticae |
|
Colourless crystals |
|
|
|
- Chemtura
- King Tech Corp
- FMC
- Duphar
|
|
- Acaroil TD
- Ovifac
- Propachem Super
- Tetrapaz
|
|
Available in a variety of formulations including emulsifiable concentrates, wettable powders and smoke generators |
|
|
|
|
|
0.078 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
82000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
255000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Chloroform |
- |
10000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Methanol |
- |
115000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Xylene |
- |
|
146 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
4.07 X 1004 |
Calculated |
- |
|
4.61 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.52 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
3.20 X 10-05 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
1.46 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
112 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Persistent |
|
112 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
8.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Alfalf leaves, n=1 |
|
|
6.1 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Published literature RL₅₀ range 5.2-7.0 days, fruit from 2 field grown crops, n=2 |
|
|
- |
- |
- |
|
- |
|
|
Stable |
C2 C = AGRITOX dataset. Dataset is no longer available. 2 = Unverified data of unknown source |
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Moderately mobile |
|
100 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
4.10 |
Calculated |
High leachability |
|
|
1.44 X 1000 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
190 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data (Other literature Log BCF range 1.7-2.0 (R3)) |
Threshold for concern |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 14700 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
200 |
- |
|
- |
- |
- |
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
> 11 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
Harmless at dose 96 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Chrysoperla carnea |
- |
|
- |
- |
- |
|
Harmless at dose 96 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
> 880 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
Low |
|
- |
- |
- |
|
> 2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 14700 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
3.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
May be absorbed into the body by inhalation of dust |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Possible liver and kidney toxicant |
|
|
|
Prevent generation of dust Flammable Tackle fires using a water spray or dry chemicals IMDG Transport Hazard Class 9 |
|
Health: H302 Environment: H400, H410 |
|
U (Unlikely to present an acute hazard) |
|
UN3077 |
|
Dispose of as chemical waste of low toxicity Packaging Group III (minor danger) |
|
- |
|
|
|
tetradifon |
|
tetradifon |
|
Tetradifon |
|
tetradifon |
|
tetradifon |
|
tetradifon |
|
- |
|
tereadifon |
|
tetradifon |
|
- |
|
- |
|
- |