Temephos (Ref: OMS 786) |
(Also known as: ENT 27165; abaphos; abathion; biothion; difenphos) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Moderately persistent; Potential for particle bound transport: Medium
 |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High
 |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
An insecticide used to control insect pests often in aquatic situations and on domestic pets |
|
Mosquitoes; Midge larvae; Black fly; Fleas |
|
Aquatic areas including lakes, wetlands, cesspools; marshes, swamps and ponds |
|
- |
|
Current |
|
1965 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₆H₂₀O₆P₂S₃ |
|
COP(=S)(OC)OC1=CC=C(C=C1)SC2=CC=C(C=C2)OP(=S)(OC)OC |
|
- |
|
WWJZWCUNLNYYAU-UHFFFAOYSA-N |
|
InChI=1S/C16H20O6P2S3/c1-17-23(25,18-2)21-13-5-9-15(10-6-13)27-16-11-7-14(8-12-16)22-24(26,19-3)20-4/h5-12H,1-4H3 |
|
Yes |
|
Insecticide, Veterinary substance |
|
Organophosphate insecticide; Organothiophosphate insecticide |
|
- |
|
- |
|
Synthetic |
|
Non-systemic. Acetylcholinesterase (AChE) inhibitor. |
|
3383-96-8 |
|
222-191-1 |
|
340 |
|
059001 |
|
5392 |
|
No data found |
|
466.47 |
|
O,O,O',O'-tetramethyl O,O'-(sulfanediyldi-4,1-phenylene) bis(phosphorothioate) |
|
O,O,O',O'-tetramethyl O,O'-thiodi-p-phenylene bis(phosphorothioate) |
|
O,O'-(thiodi-4,1-phenylene) bis(O,O-dimethyl phosphorothioate) |
|
Marine Pollutant; Evidence of use in third world countries; PAN listed Highly Hazardous Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Aedes aegypti, Aedes detritus, Anopheles albimanus, Culex pipiens, Culiseta inornata, Simulium soubrense, many others |
|
Colourless crystals |
|
|
|
- BASF
- Finechem
- Agropharm
- American Cyanamid
|
|
- Biothion
- Temefos
- Abate
- Abathion
- Swebate
- Nimitex
|
|
Usually available as emulsifiable concentrate, granules and capsules |
|
|
|
|
|
0.001 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Low |
|
9600 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
30.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
8.91 X 1004 |
Calculated |
- |
|
4.95 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.32 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
9.50 X 10-03 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Low volatility |
|
1.99 X 10-04 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
2 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
30 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature DT₅₀ approx 2 days (R3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
2 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
|
- |
|
|
10 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Non-mobile |
|
100000 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-1.48 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
2300 |
Whole fish |
Threshold for concern |
|
Not available |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
|
4,4-sulfonyldiphenol |
- |
Rat (Faecal) |
- |
- |
temephos sulfoxide |
- |
Plant; Rat (Faecal) |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
4204 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
300 |
- |
|
- |
- |
- |
|
> 1200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Eisenia foetida |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 1.55 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 3.49 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
0.00001 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.0040 |
R4 R = Peer reviewed scientific publications 4 = Verified data Chironomus salinarius 24 hr |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
1.4 |
W2 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 2 = Unverified data of unknown source Unknown species |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
4204 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
2181 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
4.79 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
Intraperitoneal LD₅₀ = 912 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
Subcutaneous LD₅₀ = 912 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
Dietary risks from food and drinking water are not of concern due to pattern of use |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Excreted mainly unchanged in the faeces |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
No further information available |
|
|
|
Prevent generation of dust and mists IMDG Transport Hazard Class 6.1 |
|
Health: H302, H311, H332, H373 Environment: H400, H410 |
|
III (Slightly hazardous) |
|
UN2811 |
|
Packaging Group III (minor danger) |
|
Stable and non-reactive under normal conditions of use, storage and transport |
|
|
|
temephos |
|
temephos |
|
Temephos |
|
temephos |
|
temefos |
|
temefos |
|
- |
|
temefos |
|
- |
|
- |
|
- |
|
- |