Saflufenacil (Ref: BAS 800H) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: Non-persistent
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Reproduction/development effects
 |
|
Used alone or mixed with glyphosate for rapid control of many dicotyledonous weeds by pre-plant and pre-emergence applications to a wide range of food crops |
|
Fleabane; Volunteer cotton; Annual ryegrass; Brome; Volunteer lupins; Marshmallow; Sowthistle; Hedge mustard; Clover; Turnip weed |
|
Fallow establishment; Commercial, industrial and public service areas; Cereals including barley, oats & wheat; Legumes |
|
- |
|
Current |
|
2008, first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₇H₁₇ClF₄N₄O₅S |
|
CC(C)N(C)S(=O)(=O)NC(=O)C1=CC(=C(C=C1Cl)F)N2C(=O)C=C(N(C2=O)C)C(F)(F)F |
|
- |
|
GNHDVXLWBQYPJE-UHFFFAOYSA-N |
|
InChI=1S/C17H17ClF4N4O5S/c1-8(2)25(4)32(30,31)23-15(28)9-5-12(11(19)6-10(9)18)26-14(27)7-13(17(20,21)22)24(3)16(26)29/h5-8H,1-4H3,(H,23,28) |
|
Yes |
|
Herbicide |
|
Uracil herbicide; Amide herbicide; Phenyluracil herbicide |
|
>945 g kg⁻¹ |
|
- |
|
Synthetic |
|
Selective, contact and residual action, PPO inhibitor |
|
372137-35-4 |
|
619-504-2 |
|
None allocated |
|
118203 |
|
11571392 |
|
No data found |
|
500.92 |
|
2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydropyrimidin-1(2H)-yl]-N-[methyl(propan-2-yl)sulfamoyl]benzamide |
|
N'-{2-chloro-4-fluoro-5-[1,2,3,6-tetrahydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoyl}-N-isopropyl-N-methylsulfamide |
|
2-chloro-5-[3,6-dihydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)-1(2H)-pyrimidinyl]-4-fluoro-N-[[methyl(1-methylethyl)amino]sulfonyl]benzamide |
|
- |
|
- |
|
E |
|
14 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
- Kixor
- Optil
- TreeVix
- Integrity
- Sharpen WG Herbicide
|
|
Available in a range of formulations including water dispersible granules and suspension concentrates |
|
|
|
|
|
2100 |
|
High |
|
275000 |
Acetone |
- |
29800 |
Methanol |
- |
2300 |
Toluene |
- |
65500 |
Ethyl acetate |
- |
|
189.9 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
3.98 X 1002 |
Calculated |
- |
|
2.6 |
|
Low |
|
|
Insoluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.595 |
|
- |
|
4.41 |
|
- |
- |
|
4.5 X 10-12 |
|
Low volatility |
|
- |
- |
- |
|
Neutral solution: maxima at 271.4nm Acidic solution: maxima at 271.8nm Basic solution: maxima at 309.4nm |
|
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
20 |
|
Non-persistent |
|
19 |
|
Non-persistent |
|
20 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
US EPA states lab studies ranging from 1 to 36 days; field DT₅₀ of 1-5 weeks in aerobic soils |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Eisenia foetida |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 98.0 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Cyprinodon variegatus |
Moderate |
|
0.997 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Pimephales promelas |
Moderate |
|
> 98.2 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderate |
|
1.33 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.087 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Lemna gibba |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
Rat |
Low |
|
2000 |
Rat |
- |
|
> 5.3 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
- |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
saflufenacil |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |