S-methoprene (Ref: SAN 810) |
(Also known as: d-methoprene; ZR 2458; methoprene) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High
 |
Human health Low alert
 Warning: Significant data are missing |
|
An insect growth regulator used to control a range of common pests including ants, fleas and ticks |
|
Diptera; Hymenoptera; Lepidoptera; Coleoptera spp. |
|
- |
|
- |
|
Current |
|
1975, USA |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
S-methoprene is the trans-form of the chiral methoprene and is more biologically active that the cis-form. |
|
C₁₉H₃₄O₃ |
|
CC(C)OC(=O)C=C(C)C=CCC(C)CCCC(C)(C)OC |
|
CC(C)OC(=O)/C=C(\C)/C=C/CC(C)CCCC(C)(C)OC |
|
NFGXHKASABOEEW-LDRANXPESA-N |
|
InChI=1S/C19H34O3/c1-15(2)22-18(20)14-17(4)11-8-10-16(3)12-9-13-19(5,6)21-7/h8,11,14-16H,9-10,12-13H2,1-7H3/b11-8+,17-14+ |
|
Yes |
|
Insecticide, Veterinary substance |
|
Juvenile hormone mimic insecticide |
|
- |
|
- |
|
Synthetic |
|
A juvenile hormone mimic (terpene). Contact and stomach action, acts by mimicing the action of the juvenile hormone keeping the insect in an immature state |
|
65733-16-6 |
|
613-834-0 |
|
- |
|
105402 |
|
1711973 |
|
607-725-00-7 |
|
310.48 |
|
- |
|
isopropyl (E,E)-(S)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
|
isopropyl (2E,4E, 7S)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
7A |
|
Not applicable |
|
- |
|
Pale yellow liquid |
|
|
|
|
|
|
|
- Biopren-BM
- Altosid
- Apex
- Diacon II
- Pharaoh's Ant Colony Eliminator
|
|
- |
|
|
|
|
|
0.515 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
100 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
96 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (Closed cup) |
- |
|
|
1.00 X 1006 |
Calculated |
- |
|
6.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
0.924 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
3.15 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Low volatility |
|
0.886 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
10 |
B3 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
10 |
B3 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
1 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Moderately fast |
|
- |
|
|
Stable |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
2535 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.60 |
Calculated |
Low leachability |
|
|
9.19 X 10-03 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
457 |
Edible |
Threshold for concern |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
5000 |
- |
|
- |
- |
- |
|
> 2250 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
C3 C = AGRITOX dataset. Dataset is no longer available. 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
< 2.0 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.76 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
0.048 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Pimephales promelas 37 day |
Moderate |
|
0.36 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
0.051 |
Daphnia magna LOEC |
Moderate |
|
0.106 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
1.33 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scenedesmus subspicatus |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
5.19 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
0.05 |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
Not highly flammable up to 263 DegC |
|
Handling: GHS09 Environment: H410 |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
S-methoprene |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
S-metopren |
|
- |
|
- |
|
- |
|
- |