S-hydroprene |
(Also known as: (7S)-hydroprene) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
Human health Moderate alert: Possible Endocrine distrupter; Possible Reproduction/development effects
 |
|
Used mainly for the control of insects in buildings and food handling establishments but also has some domestic applications |
|
Cockroaches, Beetles, moths |
|
Non-cropped areas; Public hygiene applications |
|
- |
|
- |
|
1988, first registered USA |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
The (S)-enantiomer of hydroprene which is the most biologically active. It is an enantiomer of a (R)-hydroprene. |
|
C₁₇H₃₀O₂ |
|
CCOC(=O)C=C(C)C=CCC(C)CCCC(C)C |
|
CCOC(=O)/C=C(\C)/C=C/C[C@@H](C)CCCC(C)C |
|
FYQGBXGJFWXIPP-OJROSNHMSA-N |
|
InChI=1S/C17H30O2/c1-6-19-17(18)13-16(5)12-8-11-15(4)10-7-9-14(2)3/h8,12-15H,6-7,9-11H2,1-5H3/b12-8+,16-13+/t15-/m0/s1 |
|
Yes |
|
Insecticide, Insect Growth Regulator |
|
Juvenile hormone mimic insecticide |
|
- |
|
- |
|
Synthetic |
|
A juvenile hormone mimic. Contact and stomach action, acts by duplicating the action of juvenile hormones keeping the insect in an immature state |
|
65733-18-8 |
|
634-692-6 |
|
- |
|
128996 |
|
5282198 |
|
No data found |
|
266.4 |
|
ethyl (2E,4E,7S)-3,7,11-trimethyldodeca-2,4-dienoate |
|
ethyl (2E,4E,7S)-3,7,11-trimethyldodeca-2,4-dienoate |
|
ethyl (2E,4E)-3,7,11-trimethyl-2,4-dodecadienoate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
7A |
|
Not applicable |
|
None identified |
|
Amber coloured liquid with musty odour |
|
|
|
|
|
|
|
- Mator 2E
- Mator Plus
- Gentrol
- gencor
|
|
Available as an aerosol or emulsifiable concentrate |
|
|
|
|
|
2.5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
282.3 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
3.16 X 1006 |
Calculated |
- |
|
6.5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
Low (class I) |
- |
- |
|
- |
- |
- |
|
5000 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data Rat |
- |
|
> 5.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
Acute percutaneous LD₅₀ > 5100 mg kg⁻¹ |
Rabbit |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Probable kidney, liver and gastrointestinal toxicant |
|
|
|
Highly volatile IMGD Transport Hazard Class 9 Not compatible with oxidising agents |
|
Health: H319, H331 Environment: H400 |
|
U (Unlikely to present an acute hazard) |
|
UN3082 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
S-hydroprene |
|
- |
|
- |
|
- |
|
- |
|
S-hidropreno |
|
- |
|
S-hydropren |
|
- |
|
- |
|
- |
|
- |