(R)-hexaconazole |
(Also known as: (-) hexaconazole) |
Little data is available for this specific isomer but is available for the isomer mixture. Hexaconazole is a fungicide used to control powdery mildew, scabs and rusts. It has a low aqueous solubility and a low viscosity. It tends to be environmentally persistent in both soil and aquatic systrems. It is moderately toxic to birds, fish, aquatic invertebrates, algae and earthworms but has a low toxicity to honeybees. It has a low mammalian toxicity and no information on other health issues has been identified although it my be a skin and eye irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health High alert: Endocrine distrupter
 |
|
An isomer of the conazole (imidazole) fungicide used to control both seed-borne and soil-borne diseases especially Ascomycetes and Basidiomycetes spp. |
|
Powdery mildew, Scabs, Rusts |
|
Vines; Apples; Pears,; Bananas; Vegetables; Some small grain cereals |
|
- |
|
Current |
|
1986 |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Italy |
|
Not applicable |
|
Not applicable |
|
Yes (as hexaconazole) |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
(R)-hexaconazole is the R-isomer of chiral hexaconazole |
|
C₁₄H₁₇Cl₂N₃O |
|
CCCCC(CN1C=NC=N1)(C2=C(C=C(C=C2)Cl)Cl)O |
|
CCCC[C@](CN1C=NC=N1)(C2=C(C=C(C=C2)Cl)Cl)O |
|
STMIIPIFODONDC-AWEZNQCLSA-N |
|
InChI=1S/C14H17Cl2N3O/c1-2-3-6-14(20,8-19-10-17-9-18-19)12-5-4-11(15)7-13(12)16/h4-5,7,9-10,20H,2-3,6,8H2,1H3/t14-/m0/s1 |
|
Yes |
|
Fungicide, Other substance |
|
Wood preservative, Isomer of hexaconazole |
|
Conazole fungicide |
|
- |
|
- |
|
Synthetic |
|
Broad spectrum, systemic with protective and curative action. Disrupts membrane function. Sterol biosynthesis inhibitor. |
|
221627-81-2 |
|
No data found |
|
465 |
|
128925 |
|
37888330 |
|
613-171-00-7 |
|
314.21 |
|
- |
|
(R)-2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol |
|
α-butyl-α-(2,4-dichlorophenyl)-1H-1,2,4-triazole-1-ethanol |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
3 |
|
- |
|
White crystalline solid |
|
|
|
|
|
|
|
- Passport
- Manage
- Anvil
- Planete Aster
|
|
Available in a variety of formulations including oil miscible liquids, soluble grains and suspension concentrates. |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
3.9 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature data range 2.8-5.5 days, 4 field & glasshouse crops, various matrices, n=4 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
2189 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Rat as the isomer mix |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 4000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Anas platyrhynchos as isomer mix |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
3.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss as the isomer mix |
Moderate |
|
- |
- |
- |
|
> 2.9 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna as the isomer mix |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
2189 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Rat as the isomer mix |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat as the isomer mix |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.005 |
as hexaconazole |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
USEPA - possible human carcinogen Endocrine issues - Inhibition of aromatase activity, decrease of the estrogens production |
|
|
|
No information available |
|
Health: H302, H317 Environment: H411 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
- |
|
|
|
(R)-hexaconazole |
|
(R)-hexaconazole |
|
(R)-Hexaconazol |
|
(R)-hexaconazol |
|
(R)-esaconozolo |
|
(R)-hexaconazol |
|
- |
|
(R)-heksakonazol |
|
- |
|
(R)-hexakonazol |
|
- |
|
- |