(R)-flutriafol |
(Not known by any other names) |
Little data is available for the isomer but is available for the isomeric mixture. Flutriafol is a commonly used curative and preventative fungicide. It is moderately soluble in water, tends to be persistent in soil systems and is often stable in aquatic systems. It is moderately mobile and so may leach to groundwaters under certain conditions. It is moderatley toxic to most biodiversity including honeybees and earthworms. It may be a development and/or reproduction toxin, |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Endocrine distrupter; Reproduction/development effects
 |
|
A specific isomer of a curative and preventative conazole fungicide used to control leaf and ear diseases usually in cereals |
|
Leaf and ear diseases |
|
Cereals including corn; Soybeans; Apples |
|
Wheat/Mildew=Low; Wheat/Septoria=Low; Wheat/Rust=Low; Soybean/Anthracnose=High; Soybean/Brown spot=High; Soybean/Leaf blight=Moderate; Soybean/Rust=High; Soybean/White mould=Moderate |
|
Current |
|
1981 |
|
Approved (as racemate) |
|
31/05/2024 |
|
None |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Slovakia/UK |
|
Expired |
|
No |
|
Yes (as racemate) |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Australia, Brazil, South Africa, Russia, Tanzania |
|
(R)-flutriafol is the R-isomer of chiral flutriafol |
|
C₁₆H₁₃F₂N₃O |
|
C1=CC=C(C(=C1)C(CN2C=NC=N2)(C3=CC=C(C=C3)F)O)F |
|
C1=CC=C(C(=C1)[C@@](CN2C=NC=N2)(C3=CC=C(C=C3)F)O)F |
|
InChI=1S/C16H13F2N3O/c17-13-7-5-12(6-8-13)16(22,9-21-11-19-10-20-21)14-3-1-2-4-15(14)18/h1-8,10-11,22H,9H2/t16-/m1/s1 |
|
JWUCHKBSVLQQCO-MRXNPFEDSA-N |
|
Yes |
|
Fungicide |
|
Conazole fungicide |
|
920 g kg⁻¹ |
|
EU dossier - dimethyl sulphate: <0.01%; dimethylformamide:<0.1%; methanol: <0.1% |
|
Synthetic |
|
Broad-spectrum, systemic, contact action with eradicant and protective properties. Sterol biosynthesis inhibitor. |
|
76674-21-0 |
|
No data found |
|
436 |
|
128940 |
|
13309131 |
|
No data found |
|
301.29 |
|
- |
|
(R)-2,4'-difluoro-α-(1H-1,2,4-triazol-1-ylmethyl)benzhydryl alcohol |
|
α-(2-fluorophenyl)-α-(4-fluorophenyl)-1H-1,2,4-triazole-1-ethanol |
|
Marine pollutant |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
3 |
|
- |
|
White crystalline solid |
|
|
|
|
|
|
|
- Beret Multi
- Consul
- Impact Excel
- Pointer
|
|
Often supplied as a soluble concentrate that is mixed with water and applied as a spray |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
7.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature data range 5.2-9.2 days, 2 crops, grown undercover, fruit matrix, n=2 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1140 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data Rat as isomer mix |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
616 |
Alectoris rufa as isomer mix |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
33.0 |
Lepomis macrochirus as isomer mix |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1140 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data Rat as isomer mix |
Moderate |
|
1000 |
Rat as isomer mix |
- |
|
- |
|
- |
|
- |
- |
- |
|
0.01 |
as racemate |
- |
|
0.05 |
as racemate |
- |
|
- |
- |
- |
|
0.05 |
as racemate |
- |
|
0.3-10.0 |
concentration dependent |
- |
|
- |
- |
- |
|
|
Acceptable risk for proposed uses |
|
Acceptable risk for proposed uses |
|
|
EU MRL pesticide database |
|
|
|
|
|
GB MRL expected to deviate from the EU MRL in mid-2023 |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Possible liver toxicant May cause anaemia Endocrine issues - Weak estrogen inhibition |
|
|
|
Prevent generation of mists Not explosive or oxidising IMDG Transport Hazard Class 9 |
|
Health: H340, H360fd Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
(R)-flutriafol |
|
(R)-flutriafol |
|
(R-)Flutriafol |
|
(R)-flutriafol |
|
(R)-flutriafol |
|
(R)-flutriafol |
|
- |
|
(R)-flutriafol |
|
- |
|
(R)-flutriafol |
|
- |
|
- |