Quizalofop-ethyl (Ref: DPX Y6202) |
(Also known as: quizalofop; EXP 3864; FBC 32197; INY 6202; Xylofop-ethyl) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High
 |
Human health High alert: Reproduction/development effects
 Warning: Significant data are missing |
|
A herbicide for the post-emergence control of annual and perennial grass weeds in various field crops |
|
Wild oats; Great brome; Volunteer cereals; Barley grass |
|
Field peas; Lupins; Sugarbeet |
|
- |
|
Current |
|
1984 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes (as quizalofop) |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. The technical material is an isomeric mixture of R(+)- and S(-)-enantiomers. The R-form is the more biologically active. |
|
C₁₉H₁₇ClN₂O₄ |
|
CCOC(=O)C(C)OC1=CC=C(C=C1)OC2=CN=C3C=C(C=CC3=N2)Cl |
|
- |
|
OSUHJPCHFDQAIT-UHFFFAOYSA-N |
|
InChI=1S/C19H17ClN2O4/c1-3-24-19(23)12(2)25-14-5-7-15(8-6-14)26-18-11-21-17-10-13(20)4-9-16(17)22-18/h4-12H,3H2,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Herbicide |
|
Aryloxyphenoxypropionate herbicide |
|
- |
|
- |
|
Synthetic |
|
Systemic, absorbed through leaves and translocated. An acetyl CoA carboxylase inhibitor (ACCase). |
|
76578-14-8 |
|
616-351-3 |
|
429 |
|
128711 |
|
53518 |
|
No data found |
|
372.8 |
|
rac-ethyl (2R)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate |
|
ethyl (RS)-2-[4-(6-chloroquinoxalin-2-yloxy)phenoxy]propionate |
|
ethyl 2-(4-((6-chloro-2-quinoxalinyl)oxy)phenoxy)propanoate |
|
Severe Marine Pollutant |
|
- |
|
A |
|
1 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless crystals |
|
|
|
|
|
- King Tech
- Bayer CropScience
- Nissan Chemical Industries Ltd.
|
|
|
|
Available as emulsifiable concentrates and soluble concentrates. |
|
|
|
|
|
0.31 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Low |
|
650000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
680000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Benzene |
- |
5000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Hexane |
- |
22000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Methanol |
- |
|
91.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.91 X 1004 |
Calculated |
- |
|
4.28 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.35 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
0.04 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Low volatility |
|
8.20 X 10-02 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
45 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Moderately persistent |
|
45 |
- |
Moderately persistent |
|
60 |
|
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Other sources: DT₅₀ range 1-90 days |
|
|
- |
- |
- |
|
- |
|
|
0.8 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Onion bulb, n=1 |
|
|
0.01 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Fast |
|
- |
|
|
2 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Non-persistent |
|
- |
|
- |
- |
- |
|
39 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Stable |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
540 |
|
Other sources: Log Koc 2.76 |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
2.25 |
Calculated |
Transition state |
|
|
1.12 X 10-01 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
867 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
Not available |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
1460 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Rat |
Moderate |
|
|
0.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
- |
- |
|
- |
- |
- |
|
> 2000 |
Colinus virginianus |
Low |
|
> 1123 mg kg bw⁻¹ day⁻¹ |
Colinus virginianus |
- |
|
- |
- |
- |
|
1000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
10 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
Moderately harmful at dose 1200 g./ha |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Chrysoperla carnea |
- |
|
- |
- |
- |
|
Harmful at dose 1200 g/hs |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
> 2.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
0.01 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas |
Moderate |
|
> 2.1 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Daphnia magna |
Moderate |
|
0.023 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Moderate |
|
> 0.11 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.083 |
Lemna gibba |
Moderate |
|
3.57 |
Scenedesmus subspicutus |
Moderate |
|
1 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
1460 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Rat |
Moderate |
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
5.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Occupational exposure may occur through inhalation and dermal contact |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Liver toxicant Harmful in contact with skin and if swallowed |
|
|
|
IMDG Transport Hazard Class 9 |
|
Health: H317 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN3082 |
|
Packaging Group III (minor danger) |
|
Stable in neutral and acidic media, but unstable in alkaline |
|
|
|
quizalofop-ethyl |
|
quizalofop-ethyl |
|
Quizalofop-ethyl |
|
quizalofop-ethyl |
|
quizalofop-etile |
|
quizalofop-etil |
|
- |
|
kwizalofop etylowy |
|
- |
|
quinzalofop-etil |
|
- |
|
- |