Quinalphos (Ref: ENT 27397) |
(Also known as: chinalphos; SAN 6538; SAN 6626; diethquinalphion) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High; Bees acute oral ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
A broad-spectrum insecticide and acaricide used against a range of common insect pests |
|
Caterpillars; Aphids; Mealybugs; Mites; Bollworms; Leaf hoppers; Borers |
|
Rape; Peanuts; Sorghum; Wheat; Sugarcane; Fibre crops; Cotton; Vines & grapes |
|
- |
|
- |
|
circa 1970 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₂H₁₅N₂O₃PS |
|
CCOP(=S)(OCC)OC1=NC2=CC=CC=C2N=C1 |
|
No data |
|
JYQUHIFYBATCCY-UHFFFAOYSA-N |
|
InChI=1S/C12H15N2O3PS/c1-3-15-18(19,16-4-2)17-12-9-13-10-7-5-6-8-11(10)14-12/h5-9H,3-4H2,1-2H3 |
|
Yes |
|
Insecticide, Acaricide |
|
Organophosphate insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
- |
|
- |
|
Synthetic |
|
Contact and stomach action. Non-systemic. Acetylcholinesterase (AChE) inhibitor. |
|
13593-03-8 |
|
237-031-6 |
|
449 |
|
- |
|
26124 |
|
015-138-00-7 |
|
298.3 |
|
O,O-diethyl O-quinoxalin-2-yl phosphorothioate |
|
O,O-diethyl O-quinoxalin-2-yl phosphorothioate |
|
O,O-diethyl O-2-quinoxalinyl phosphorothioate |
|
Marine Pollutant; Subject to the provisions of the UK Poisons Act 1972 |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Bemisia tabaci, Helicoverpa armigera, Myzus persicae, Pectinophora gossypiella, Spodoptera litura, many others |
|
Colourless crystals |
|
|
|
- Cheminova
- Sigma-aldrich
- United Phosphorus
- King Tech Corp
- Bayer
- Sandoz
|
|
- Quinguard
- Deviquin
- Hubelux
- Quinatox
- Bayrusil
- Ekalux
- Savall
|
|
Available as emulsifiable concentrates, ULVs, granules, dusts and wettable powders |
|
|
|
|
|
17.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
250000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
31.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.75 X 1004 |
Calculated |
- |
|
4.44 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.235 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
0.346 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
4.70 X 10-03 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
21 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
1.4 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Tea, green leaves, n=1 |
|
|
2.9 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 1.2-8.3 days, 9 field crops, various matrices, n=12 |
|
|
- |
- |
- |
|
- |
|
|
39 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Moderately persistent |
|
pH sensitive: DT₅₀ 23 days at pH 3, 39 days at pH 6, 26 days at pH 9, all at 25 °C |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
S1 S = Expert judgement 1 = Estimated data with little or no verification |
Slightly mobile |
|
1465 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.10 |
Calculated |
Low leachability |
|
|
2.09 X 10-02 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
71 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
> 3 |
- |
|
- |
- |
- |
|
> 4.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
High |
|
- |
- |
- |
|
- |
- |
- |
|
118.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
0.44 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
High |
|
0.07 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
> 0.04 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Bombus terrestris |
High |
- |
|
> 0.17 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus terrestris |
High |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.005 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
0.00066 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
71 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
1750 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
0.45 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Highly toxic, may be fatal if inhaled, swallowed or absorbed through skin |
|
|
|
Corrosive when molten IMDG Transport Hazard Class 6.1 |
|
Health: H301, H312 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN2783 |
|
Packaging Group II (moderate danger) |
|
- |
|
|
|
quinalphos |
|
quinalphos |
|
Quinalphos |
|
quinalphos |
|
quinalfos |
|
quinalfos |
|
quinalphos |
|
kwinalfos |
|
- |
|
- |
|
quinalfos |
|
- |