Pyributicarb (Ref: TSH-888) |
(Not known by any other names) |
Pyributicarb is a monothiocarbamic ester used as a herbicide which also demonstrates some fungicidal activity. It is used for the control of grasses in rice paddy fields. It is almost insoluble in water and is not persistent in paddy fields with a half life of 13-18 days. It is highly toxic to aquatic organisms. It does not appear to be highly toxic to mammals but may be an irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Low alert
 Warning: Significant data are missing |
|
A herbicide for the control of grasses in rice paddy fields and in other situations |
|
Annual grasses, including Echinochloa oryzicola, Cyperus difformis and Monochoria vaginalis |
|
Rice; Turf |
|
- |
|
Novel, current |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval foe use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applixcable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₈H₂₂N₂O₂S |
|
CC(C)(C)C1=CC(=CC=C1)OC(=S)N(C)C2=NC(=CC=C2)OC |
|
- |
|
VTRWMTJQBQJKQH-UHFFFAOYSA-N |
|
InChI=1S/C18H22N2O2S/c1-18(2,3)13-8-6-9-14(12-13)22-17(23)20(4)15-10-7-11-16(19-15)21-5/h6-12H,1-5H3 |
|
Yes |
|
Herbicide, Fungicide |
|
Thiocarbamate herbicide; Carbamate herbicide |
|
- |
|
- |
|
Synthetic |
|
Sterol biosynthesis inhibitor. Systemic, absorbed by the roots, leaves and stem and translocated to active growth sites where it inhibits elongation of the roots and aerial parts. |
|
88678-67-5 |
|
618-200-7 |
|
- |
|
- |
|
- |
|
No data found |
|
330.44 |
|
O-(3-tert-butylphenyl) (6-methoxypyridin-2-yl)methylcarbamothioate |
|
O-(3-tert-butylphenyl) (6-methoxy-2-pyridyl)methylcarbamothioate |
|
O-(3-(1,1-dimethylethyl)phenyl) N-(6-methoxy-2-pyridinyl)-N-methylcarbamothioate |
|
- |
|
- |
|
Not known |
|
Not known |
|
Not applicable |
|
18 |
|
- |
|
White crystalline powder |
|
|
|
- |
|
- Seezet Flowable
- Opryzaguard
|
|
- |
|
|
|
|
|
0.32 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
28000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Methanol |
- |
780000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Acetone |
- |
33000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethanol |
- |
560000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethyl acetate |
- |
|
86 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
0.269 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source at 40 °C |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature: soil half life in paddy fields 13-18 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Slightly mobile |
|
1885 |
|
General literature |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 11.0 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
> 15.0 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
- |
- |
- |
|
> 6.52 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
No information available |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
Environment: H400, H410 |
|
- |
|
UN2757 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
pyributicarb |
|
pyributicarbe |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |