Pyrazosulfuron |
(Also known as: Agreen; pyrazosulphuron-ethyl) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity Low alert: Birds acute ecotoxicity: Low; Fish acute ecotoxicity: Low; Daphnia acute ecotoxicity: Low; Bees acute contact ecotoxicity: Low; Earthworms acute ecotoxicity: Low
 |
Human health Low alert
 Warning: Significant data are missing |
|
Mainly used, as the ethyl variant, to control broad-leaved weeds, grasses and sedges in rice |
|
Barnyard grass; Tidalmarsh flatsedge (Cyperus serotinus); Jungle rice (Echinochloa colona) |
|
Rice |
|
- |
|
Current |
|
1989, first reported; 1990, first introduced |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Netherlands |
|
Expired |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₂H₁₄N₆O₇S |
|
CN1C(=C(C=N1)C(=O)O)S(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC)OC |
|
- |
|
VXMNDQDDWDDKOQ-UHFFFAOYSA-N |
|
InChI=1S/C12H14N6O7S/c1-18-9(6(5-13-18)10(19)20)26(22,23)17-12(21)16-11-14-7(24-2)4-8(15-11)25-3/h4-5H,1-3H3,(H,19,20)(H2,14,15,16,17,21) |
|
Yes |
|
Herbicide |
|
Sulfonylurea herbicide; Pyrazole herbicide; Pirimidinylsulfonylurea herbicide; Urea herbicide |
|
- |
|
- |
|
Synthetic |
|
Broad-spectrum activity, absorbed by roots and translocated through out plant by controlling the synthesis of amino acids. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
|
98389-04-9 |
|
619-342-2 |
|
None allocated |
|
- |
|
93525 |
|
No data found |
|
386.34 |
|
5-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-1-methyl-1H-pyrazole-4-carboxylic acid |
|
5-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-1-methyl-1H-pyrazole-4-carboxylic acid |
|
5-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-1-methyl-1H-pyrazole-4-carboxylic acid |
|
- |
|
- |
|
B |
|
2 |
|
Not applicable |
|
Not applicable |
|
Bacopa rotundifolia, Cyperus difformis |
|
Solid |
|
|
|
|
|
- Nissan Chemicals
- King Tech Corp
|
|
- Sirius 70 WG
- Sideral
- Saathi
- Act
- Sunwell
|
|
Usually supplied as wettage granules, suspension concentrates and wettable powders |
|
|
|
|
|
14.5 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C as ethyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.45 X 1003 |
Calculated |
- |
|
3.16 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source as ethyl variant |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
0.0147 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source as ethyl variant |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
15 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source as ethyl variant |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Mouse as ethyl variant |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2250 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Colinus virginianus as ethyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 8000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Eisenia foetida as ethyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Apis mellifera as ethyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
180.0 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Oncorhynchus mykiss as ethyl variant |
Low |
|
- |
- |
- |
|
> 700 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna as ethyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 150 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Scenedesmus acutus as ethyl variant |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Mouse as ethyl variant |
Low |
|
2000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Rat |
- |
|
3.9 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
- |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
pyrazosulfuron |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
pirazosulfuron |
|
- |
|
- |
|
- |
|
- |