Propyrisulfuron |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
A sulfonylurea herbicide for use on rice crops to control annual and perennial weeds especially those that have developed resistance to sulfonylurea herbicides |
|
Banyardgrass; Water chestnut; Arrowhead |
|
Paddy rice |
|
- |
|
Current |
|
2008 report; 2010 launched Japan |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₆H₁₈ClN₇O₅S |
|
CCCC1=NN2C(=NC(=C2S(=O)(=O)NC(=O)NC3=NC(=CC(=N3)OC)OC)Cl)C=C1 |
|
- |
|
PYCINWWWERDNKE-UHFFFAOYSA-N |
|
InChI=1S/C16H18ClN7O5S/c1-4-5-9-6-7-10-18-13(17)14(24(10)22-9)30(26,27)23-16(25)21-15-19-11(28-2)8-12(20-15)29-3/h6-8H,4-5H2,1-3H3,(H2,19,20,21,23,25) |
|
Yes |
|
Herbicide |
|
Pyrimidinylsulfonylurea herbicide; Sulfonylurea herbicide; Urea herbicide |
|
- |
|
- |
|
Synthetic |
|
ALS inhibitor |
|
570415-88-2 |
|
875-504-4 |
|
None allocated |
|
- |
|
11990852 |
|
No data found |
|
455.88 |
|
2-chloro-N-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]-6-propylimidazo[1,2-b]pyridazine-3-sulfonamide |
|
1-(2-chloro-6-propylimidazo[1,2-b]pyridazin-3-ylsulfonyl)-3-(4,6-dimethoxypyrimidin-2-yl)urea |
|
2-chloro-N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-6-propylimidazo[1,2-b]pyridazine-3-sulfonamide |
|
- |
|
- |
|
B |
|
2 |
|
Not applicable |
|
Not applicable |
|
None identified |
|
White solid |
|
|
|
|
|
|
|
Often supplied in granular formulations |
|
|
|
|
|
0.98 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low |
|
0.01 |
R4 R = Peer reviewed scientific publications 4 = Verified data Hexane |
- |
0.156 |
R4 R = Peer reviewed scientific publications 4 = Verified data Toluene |
- |
28600 |
R4 R = Peer reviewed scientific publications 4 = Verified data Chloroform |
- |
16100 |
R4 R = Peer reviewed scientific publications 4 = Verified data Ethyl acetate |
- |
|
193.5 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
7.94 X 1002 |
Calculated |
- |
|
2.9 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.775 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
4.89 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
4.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
13.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature data - rapid degradation. Field studies DT₅₀ range 5-22 days. |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
- |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately mobile |
|
274 |
|
- |
|
Literature data Koc range 138-410 mL g⁻¹ |
|
- |
|
|
|
|
|
1.77 |
Calculated |
Low leachability |
|
|
3.90 X 10-02 |
Calculated |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2250 |
R4 R = Peer reviewed scientific publications 4 = Verified data Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 10 |
R4 R = Peer reviewed scientific publications 4 = Verified data Cyprinus carpio |
Moderate |
|
- |
- |
- |
|
> 10 |
R4 R = Peer reviewed scientific publications 4 = Verified data Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 0.011 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Pseudokirchneriella subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
> 4.3 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
None allocated at this time |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
propyrisulfuron |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |