Prometryn (Ref: C 34161) |
(Also known as: prometryne) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High
 |
Human health High alert: Endocrine distrupter
 |
|
A herbicide used to control annual grasses and broad-leaved weeds in a variety of crops |
|
Grasses including barnyard grass, goosegrass, ryegrass, prairies grass; Broad-leaved weeds including deadnettle, nightshade, chickweed, fathen, common spurry |
|
Cotton; Celery; Pigeon peas; Dill; Potatoes; Sunflowers; Carrots; Peanuts |
|
- |
|
Current |
|
1964, first registered USA |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₀H₁₉N₅S |
|
CC(C)NC1=NC(=NC(=N1)SC)NC(C)C |
|
No data |
|
AAEVYOVXGOFMJO-UHFFFAOYSA-N |
|
InChI=1S/C10H19N5S/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
prometryn |
- |
 |
|
Herbicide |
|
Triazine herbicide; Methylthiotriazine herbicide |
|
96% |
|
- |
|
Synthetic |
|
A selective, systemic, contact and residual triazine, a photosynthetic electron transport inhibitor at the photosystem II receptor site |
|
7287-19-6 |
|
230-711-3 |
|
93 |
|
080805 |
|
4929 |
|
No data found |
|
241.36 |
|
- |
|
N2,N4-diisopropyl-6-methylthio-1,3,5-triazine-2,4-diamine |
|
N,N'-bis(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
|
Potential groundwater contaminant |
|
- |
|
C1 |
|
5 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless crystalline solid |
|
|
|
- Ciba Geigy
- Makhteshim-Agan
- BOC Sciences
|
|
- Caparol
- Gesaguard
- Primetol Q
- Prometex
|
|
Often supplied as a wettable powder |
|
|
|
|
|
33 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Low |
|
240000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
5500 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Hexane |
- |
160000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Methanol |
- |
170000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Toluene |
- |
|
119 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
300 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.19 X 1003 |
Calculated |
- |
|
3.34 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.157 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
4.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source at 25 °C |
- |
Weak base, pKb = 9.95 |
|
0.13 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
1.20 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
41 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately persistent |
|
41 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Other sources: DT₅₀ 60 days (DW4) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
30 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Stable |
|
Degraded by UV light |
|
|
Stable |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Stable |
|
Stable under normal environmental conditions, hydrolysed in acidic and alkaline media |
|
38 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately fast |
|
56 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Stable |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Moderately mobile |
|
400 |
|
- |
|
|
53.26 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-mobile |
|
4330 |
|
0.86 |
|
Kf range 4.22-165 mL g⁻¹, Kfoc range 122-12692 mL g⁻¹, 1/n range 0.57-1.18, Soils=3 |
|
- |
|
|
|
|
|
0.59 |
Calculated |
Low leachability |
|
|
1.13 X 10-02 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
85 |
Whole fish |
Low potential |
|
Not available |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
Aerobic |
|
- |
- |
- |
|
- |
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
750 |
- |
|
- |
- |
- |
|
> 2150 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Anas platyrhynchos |
Low |
|
> 500 ppm |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Anas platyrhynchos |
- |
|
- |
- |
- |
|
153 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
99 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
Harmless at dose 10 g ha⁻¹ |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
5.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
0.08 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Cyprinus carpio 60 day |
Moderate |
|
12.66 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
2 |
Daphnia magna |
Moderate |
|
1.4 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.0105 |
Lemna gibba |
Moderate |
|
0.002 |
Scenedesmus acutus |
High |
|
> 0.0025 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Chlamydomonas reinhardtii |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
2020 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
> 5.17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Possible kidney and liver toxicant Possible blood toxicant |
|
|
|
No information available |
|
Health: H332 Environment: H400, H410 |
|
III (Slightly hazardous) |
|
UN3077 |
|
- |
|
Limited shelf-life |
|
|
|
prometryn |
|
prometryne |
|
Prometryn |
|
prometryn |
|
prometrina |
|
prometrina |
|
- |
|
prometryn |
|
- |
|
prometryn |
|
- |
|
- |