Primisulfuron |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Carcinogen
 |
|
An urea herbicide used on crop and non-crop areas for the control of grass and many broad-leaved weeds |
|
Grasses including Kentucky bluegrass; Broad-leaved weeds |
|
Corn; Non-cropped areas |
|
- |
|
- |
|
1990 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₄H₁₀F₄N₄O₇S |
|
C1=CC=C(C(=C1)C(=O)O)S(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC(F)F)OC(F)F |
|
No data |
|
GPGLBXMQFQQXDV-UHFFFAOYSA-N |
|
InChI=1S/C14H10F4N4O7S/c15-11(16)28-8-5-9(29-12(17)18)20-13(19-8)21-14(25)22-30(26,27)7-4-2-1-3-6(7)10(23)24/h1-5,11-12H,(H,23,24)(H2,19,20,21,22,25) |
|
Yes |
|
Herbicide, Metabolite |
|
Soil |
|
Sulfonylurea herbicide; Pyrimidinylsulfonylurea herbicide; Urea herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic, absorbed through roots and foliage. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
|
113036-87-6 |
|
No data found |
|
712 |
|
- |
|
91774 |
|
No data found |
|
454.31 |
|
- |
|
2-[4,6-bis(difluoromethoxy)pyrimidin-2-ylcarbamoylsulfamoyl]benzoic acid |
|
2-[[[[[4,6-bis(difluoromethoxy)-2-pyrimidinyl]amino]carbonyl]amino]sulfonyl]benzoic acid |
|
- |
|
- |
|
B |
|
2 |
|
Not applicable |
|
Not applicable |
|
Amaranthus hybridus, Amaranthus rudis, Sorghum bicolor |
|
Colourless crystalline solid |
|
|
|
|
|
|
|
70 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Moderate |
|
35000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Acetone |
- |
1000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Ethanol |
- |
570 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Toluene |
- |
1.5 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data n-Hexane |
- |
|
196.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.58 X 1000 |
Calculated |
- |
|
0.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.64 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
3.47 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
Weak acid |
|
5.00 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
4.00 X 10-02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
30 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Moderately persistent |
|
- |
- |
- |
|
16 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Field studies DT₅₀ range 4-29 days. Other studies DT₅₀ 31–62 days (P3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
248 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Stable |
|
DT₅₀ 20.6 at pH 5, natural sunlight conditions, 30 days |
|
|
Stable |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Stable |
|
Stable pH 7 to pH 9, hydrolysis does occur under acidic conditions, DT₅₀ 25 days at pH 5 |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
M3 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 3 = Unverified data of known source |
Mobile |
|
50 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
2.77 |
Calculated |
Transition state |
|
|
1.40 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5050 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
2150 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
1000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
100 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
24 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source Oncorhynchus mykiss |
Moderate |
|
13 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Oncorhynchus mykiss |
Low |
|
260 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Low |
|
0.42 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.8 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Lemna gibba |
Moderate |
|
0.012 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Pseudokirchneriella subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5050 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source Rat |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
- |
|
4.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
Occupational exposure may occur through dermal contact |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Possible liver and kidney toxicant at high doses |
|
|
|
No information available |
|
Environment: H400, H410 |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
primisulfuron |
|
primisulfuron |
|
Primisulfuron |
|
primisulfuron |
|
primisulfuron |
|
primisulfuron |
|
- |
|
primisulfuron |
|
- |
|
- |
|
- |
|
- |