Piperonyl butoxide (Ref: ENT 14250) |
(Also known as: PBO; butacide; butoxide) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate
 |
Human health High alert: Endocrine distrupter; Neurotoxicant
 |
|
An unclassified synergist used in a wide variety of insecticides to provide enhanced performance of the active ingredient |
|
- |
|
circa 1950 |
|
Approved |
|
31/12/2030 |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable - not a ppp. May be authorised at national level under different legislation |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
- |
|
C₁₉H₃₀O₅ |
|
CCCCOCCOCCOCC1=CC2=C(C=C1CCC)OCO2 |
|
No data |
|
FIPWRIJSWJWJAI-UHFFFAOYSA-N |
|
InChI=1S/C19H30O5/c1-3-5-7-20-8-9-21-10-11-22-14-17-13-19-18(23-15-24-19)12-16(17)6-4-2/h12-13H,3-11,14-15H2,1-2H3 |
|
Yes |
|
Other substance, Veterinary substance |
|
Performance enhancer, Synergist |
|
Cyclic aromatic |
|
- |
|
- |
|
Synthetic |
|
Blocks pests natural detoxification system. Synergist. P450-dependent monooxygenase inhibitor. |
|
51-03-6 |
|
200-076-7 |
|
33 |
|
067501 |
|
- |
|
338.44 |
|
- |
|
5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole |
|
5-((2-(2-butoxyethoxy)ethoxy)methyl)-6-propyl-1,3-benzodioxole |
|
Listed on USA Toxic Release Inventory |
|
- |
|
Not applicable |
|
Not applicable |
|
27A |
|
Not applicable |
|
Aedes aegypti, Culex pipiens, Musca domestica, Pectinophora gossypiella, Rhizopertha dominica, many others |
|
Colourless to yellow oily liquid |
|
|
|
- AgroCare
- Agropharm
- Bayer
- Cooper
|
|
- Pyrocide
- Rotacide
- Meteor-Plus
|
|
Available in a range of formulations including dusts, emulsifiable concentrates, foggers, paper coatings, pressurized sprays, wettable powders, shampoos and as impregnated collars |
|
|
|
|
|
14.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
Not applicable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
164 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
179 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
5.62 X 1004 |
Calculated |
- |
|
4.75 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.06 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
2.00 X 10-02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
2.30 X 10-06 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
50.39 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
|
|
|
- |
|
|
13 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
14.3 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 3.3-25.3 days, 2 field crops, various matrices, n=2 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
250 |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Persistent |
|
Stable pH 5 to pH 9 at 25 °C |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Non-mobile |
|
89125 |
|
Other data: Koc range 399-830 mL g⁻¹ (L3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-1.06 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
260 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Lepomis macrochinis |
Threshold for concern |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 7220 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
30 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
- |
- |
|
- |
- |
- |
|
> 2250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
294 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Apis mellifera |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
5.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinidae |
Moderate |
|
- |
- |
- |
|
0.51 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
Moderate |
|
0.12 |
Daphnia magna LOEC |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.24 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 7220 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
1880 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
> 5.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
Intraperitoneal LDLo = 1000 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Mouse |
- |
|
0.2 |
JMPR 1995 |
- |
|
None allocated |
JMPR 2002 |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Majority of dose eliminated in faeces |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Possible liver toxicant NB: Some sources dispute carcinogenicity IARC Group 3 carcinogen; USEPA - possible human carcinogen |
|
|
|
Not explosive IMDG Transport Hazard Class 9 |
|
Health: H330, H361 Environment: H400, H410 |
|
U (Unlikely to present an acute hazard) |
|
UN3082 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
piperonyl butoxide |
|
pipéronyl butoxyde |
|
Piperonylbutoxid |
|
piperonylbutoxyd |
|
piperonil butossido |
|
butoxido de piperonilo |
|
- |
|
piperonyl butoksydu |
|
piperonylbutoxid |
|
- |
|
- |
|
- |