Phoxim (Ref: OMS 1170) |
(Also known as: phoxime; BAY 5621) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High
 |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
An insecticide and acaricide used to control stored-product pests such as ants and some soil insects. Also used as a disinfectant. |
|
Locusts; lepidopterous larvae; Caterpillars |
|
Potatoes; Cotton; Maize; Sugarbeet |
|
- |
|
- |
|
1970 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Finland |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric |
|
C₁₂H₁₅N₂O₃PS |
|
CCOP(=S)(OCC)ON=C(C#N)C1=CC=CC=C1 |
|
CCOP(=S)(OCC)O/N=C(\C#N)/C1=CC=CC=C1 |
|
ATROHALUCMTWTB-WYMLVPIESA-N |
|
InChI=1S/C12H15N2O3PS/c1-3-15-18(19,16-4-2)17-14-12(10-13)11-8-6-5-7-9-11/h5-9H,3-4H2,1-2H3/b14-12+ |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
chlorphoxim |
Variant |
 |
|
Insecticide, Other substance , Veterinary substance |
|
Disinfectant |
|
Organophosphate insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
- |
|
- |
|
Synthetic |
|
Non-systemic with contact and stomach action. Short activity period. Acetylcholinesterase (AChE) inhibitor. |
|
14816-18-3 |
|
238-887-3 |
|
364 |
|
598800 |
|
9570290 |
|
015-100-00-X |
|
298.3 |
|
- |
|
O,O-diethyl α-cyanobenzylideneaminooxyphosphonothioate |
|
4-ethoxy-7-phenyl-3,5-dioxa-6-aza-4-phosphaoct-6-ene-8-nitrile 4-sulphide |
|
OSPAR soc |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Amblyseius nicholsii, Anopheles albimanus, Anopheles sacharovi, Culex quinquefasciatus, Heliothis assulta, many others |
|
Yellow liquid |
|
|
|
- FCC Ltd
- Bayer CropScience
- King Tech
|
|
- Superxim
- Phoxim 50
- Liben
- Volaton
|
|
Available in a variety of formulations including aerosols, baits, dustable powders, emulsifiable concentrates, seed dressings, granules and ULV liquid. |
|
|
|
|
|
1.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
250000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Xylene |
- |
250000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Dichloromethane |
- |
250000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Acetone |
- |
136000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Heptane |
- |
|
5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes on distillation |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.40 X 1003 |
Calculated |
- |
|
3.38 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.18 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
2.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
4.18 X 10-01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
6 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
0.24 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Tea, green leaves, n=1 |
|
|
1.7 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Published literature RL₅₀ range 1.5-2.1 days, 3 field crops, various matrices, n=3 |
|
|
- |
- |
- |
|
- |
|
|
7.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
pH sensitive: DT₅₀ 26.7 days at pH 4, 3.1 days at pH 9, all at 22 °C |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
33.33 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Slightly mobile |
|
1148 |
|
1.03 |
|
Kf range 27.0-44.0 (802 for peat) mL g⁻¹, Kfoc range 997-1243 (1333 for peat) mL g⁻¹, 1/n - no data, Soils=4 |
|
- |
|
|
|
|
|
0.73 |
Calculated |
Low leachability |
|
|
5.12 X 10-03 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
1610 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Whole body |
Threshold for concern |
|
Not available |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
> 15 |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 40.4 |
R4 R = Peer reviewed scientific publications 4 = Verified data Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.22 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
- |
- |
- |
|
0.00081 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
< 0.1 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Anabaena variabilis 5 day |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
4.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Harmful if swallowed |
|
|
|
Flammable |
|
Health: H302, H317, H361f Environment: H400, H410 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
phoxim |
|
phoxime |
|
Phoxim |
|
phoxim |
|
foxim |
|
foxim |
|
phoxim |
|
foksim |
|
foxim |
|
- |
|
foxim |
|
- |