Pentanochlor (Ref: FMC 4512) |
(Also known as: solan; CMMP; pentanachlore) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Drainflow: Mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Daphnia acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Endocrine distrupter
 Warning: Significant data are missing |
|
A pre- and post-emergence herbicide used in a wide range of crops |
|
Chickweed; Red shank; Knotgrass; Barnyardgrass |
|
Rice; Vegetables including carrots, celeriac and celery; Tomatoes; Ornamentals; Herbs including fennel and parsley |
|
- |
|
Unknown |
|
1960, first reported |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A molecule with one chiral centre. The technical material is a racemate. |
|
C₁₃H₁₈ClNO |
|
CCCC(C)C(=O)NC1=CC(=C(C=C1)C)Cl |
|
No data |
|
WGVWLKXZBUVUAM-UHFFFAOYSA-N |
|
InChI=1S/C13H18ClNO/c1-4-5-10(3)13(16)15-11-7-6-9(2)12(14)8-11/h6-8,10H,4-5H2,1-3H3,(H,15,16) |
|
Yes |
|
Herbicide |
|
Anilide herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective with contact action. Photosynthetic electron transport inhibitor at the photosystem II. |
|
2307-68-8 |
|
218-988-9 |
|
317 |
|
020901 |
|
16826 |
|
No data found |
|
239.7 |
|
- |
|
(RS)-3'-chloro-2-methylvaler-p-toluidide |
|
N-(3-chloro-4-methylphenyl)-2-methylpentanamide |
|
- |
|
- |
|
C2 |
|
7 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless solid |
|
|
|
|
|
- Croptex bronze
- Atlas brown
- Solan
- Dakuron
|
|
Usually suppled as an emulsifiable concentrate |
|
|
|
|
|
8.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
250000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Xylene |
- |
|
85.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.04 X 1004 |
Calculated |
- |
|
4.31 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.11 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
0.3 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low volatility |
|
1.59 X 10-03 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
4 |
S1 S = Expert judgement 1 = Estimated data with little or no verification |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Mobile |
|
30 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.52 |
Calculated |
Low leachability |
|
|
3.50 X 10-03 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 4 month |
- |
|
> 20000 |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
4.8 |
S1 S = Expert judgement 1 = Estimated data with little or no verification Unknown species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.05 |
S1 S = Expert judgement 1 = Estimated data with little or no verification Unknown species |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Harmful if swallowed, via skin contact and inhalation |
|
|
|
Highly flammable |
|
Not classified: Obsolete |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
pentanochlor |
|
pentanochlore |
|
Pentanochlor |
|
pentanochlor |
|
pentanoclor |
|
pentanoclor |
|
- |
|
pentanochlor |
|
- |
|
- |
|
- |
|
- |