Pentachlorophenol |
(Also known as: PCP; penchlorol; chlorophen) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Endocrine distrupter; Reproduction/development effects; Neurotoxicant
 |
|
A multi-action pesticide used to control wood boring insects, wood fungal rots and as a general herbicide |
|
Defoliant; Wood-damaging insects including termites; Timber rot |
|
Cotton; Utility wood structures such as railway sleepers, utility poles, fencing |
|
- |
|
Unknown |
|
circa 1936 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₆HCl₅O |
|
C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)O |
|
No data |
|
IZUPBVBPLAPZRR-UHFFFAOYSA-N |
|
InChI=1S/C6HCl5O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
pentachlorophenol |
- |
 |
|
Insecticide, Herbicide, Fungicide, Molluscicide, Plant Growth Regulator, Wood preservative |
|
Organochloride insecticide; Organochloride herbicide; Organochloride fungicide |
|
- |
|
- |
|
Synthetic |
|
Accelerates aerobic metabolism and increases heat production |
|
87-86-5 |
|
201-778-6 |
|
106 |
|
063001 |
|
992 |
|
604-002-00-8 |
|
266.34 |
|
- |
|
pentachlorophenol |
|
pentachlorophenol |
|
WFD priority substance; Subject to PIC regulations; Regulated POP; Severe Marine Pollutant; Rotterdam Convention (Class Ib); UK non-statutory standard for dry soil: <0.06 mg/Kg |
|
EU Directive 2008/105/EC EQS surface waters: annual average 0.4 µg l⁻¹; max measured 1.0 µg l⁻¹ UK statutory standard for the protection of aquatic life: annual average for inland, coastal and territorial waters: 2 µg l⁻¹ |
|
Not known |
|
Not known |
|
2A |
|
Not known |
|
- |
|
Colourless crystals |
|
|
|
|
|
1000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
High |
|
500000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Acetone |
- |
150000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Benzene |
- |
1800000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Methanol |
- |
12000000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Ethanol |
- |
|
191 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
309 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
2.09 X 1003 |
Calculated |
- |
|
3.32 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
High |
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
1.99 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
- |
|
4.73 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
Weak acid |
|
16000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
4.30 X 10-01 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
63 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Moderately persistent |
|
48 |
|
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Data DT₅₀ range 46-63 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
0.03 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Fast |
|
- |
|
|
Stable |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes |
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Mobile |
|
30 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
4.24 |
Calculated |
High leachability |
|
|
1.43 X 1000 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
216 |
Whole body (Other literature values Log BCF range 1.2-3.2 (R3)) |
Threshold for concern |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
80 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Rat |
High |
|
|
3.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
- |
- |
|
- |
- |
- |
|
> 380 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Anas platyrhynchos |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
48 |
Eisenia foetida |
Moderate |
|
10 |
Eisenia foetida |
Moderate |
|
- |
- |
- |
|
|
64.0 |
Folsomia candida 33d |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
48 |
Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
0.05 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Carassius auratus |
Moderate |
|
> 0.45 |
Daphnia magna |
Moderate |
|
> 0.18 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
Moderate |
|
- |
- |
- |
|
0.11 |
Chironomus riparius 2 day |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
0.12 |
Lemna gibba |
Moderate |
|
0.08 |
Scenedesmus quadricauda |
Moderate |
|
> 0.4 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Chlorella pyrenoidosa |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
80 |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes Rat |
High |
|
105 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
0.355 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
Readily absorbed through the skin |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
Non-statutory WHO drinking water guideline 0.009 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Liver and thyroid toxicant Heart failure may occur following acute inhalation Bioaccumulates IARC group 2B carcinogen; USEPA - probable human carcinogen Endocrine issues - Weak estrogenic and anti-androgenic affect |
|
|
|
Prevent generation of dust Not expected to autoignite; Not highly flammable IMDG Transport Hazard Class 6.1 |
|
Health: H301, H311, H315, H319, H330, H335, H351 Environment: H400, H410 |
|
Ib (Highly hazardous) |
|
UN3155 |
|
Packaging Group II (moderate danager) |
|
- |
|
|
|
pentachlorophenol |
|
pentachlorophénol |
|
Pentachlorphenol |
|
pentachlorphenol |
|
pentaclorofenolo |
|
pentaclorofenato |
|
- |
|
pentachlorofenol |
|
- |
|
- |
|
pentachloorfenol |
|
- |