Nabam |
(Also known as: nabame; DSE; parzate) |
Nabam is a toxic fungicide, considered to be a carcinogen and there are some concerns that it may be an endocrine disrupter. It is very soluble in water, hydrolyzes rapidly, rapidly degrades in soil and so leaching to groundwater is unlikely. Its ETU metabolite is an environmental concern. Highly toxic to aquatic organisms. It is not toxic to honeybees. Toxicity data for other species has not been found. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity High alert: Daphnia acute ecotoxicity: High
 |
Human health High alert: Carcinogen; Reproduction/development effects
 |
|
A fungicide, algicide and bactericide used in a variety of situations including control of fungal pathogens on crops, to protect harvest produce in storage and as an industrial microbiocide |
|
Broad spectrum of fungal pathogens |
|
Crops including cotton, capsicums, onions, tomatoes, potatoes and rice; Non-food applications including aquatic stiuations, water cooling systems, industrial sites |
|
- |
|
Considered obsolete but may be available in some countries |
|
circa 1945 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₄H₆N₂Na₂S₄ |
|
C(CNC(=S)[S-])NC(=S)[S-].[Na+].[Na+] |
|
No data |
|
UQJQVUOTMVCFHX-UHFFFAOYSA-L |
|
InChI=1S/C4H8N2S4.2Na/c7-3(8)5-1-2-6-4(9)10;;/h1-2H2,(H2,5,7,8)(H2,6,9,10);;/q;2*+1/p-2 |
|
Yes |
|
Fungicide, Algicide, Bactericide, Biocide |
|
Carbamate fungicide; Dithiocarbamate fungicide |
|
- |
|
- |
|
Synthetic |
|
Non-specific, exact mode of action is unclear but thought to inhibit protein development. |
|
142-59-6 |
|
205-547-0 |
|
21 |
|
014503 |
|
3032297 |
|
006-014-00-3 |
|
256.34 |
|
- |
|
disodium ethylenebis(dithiocarbamate) |
|
disodium 1,2-ethanediylbis(carbamodithioate) |
|
Marine Pollutant |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
28 |
|
- |
|
Colourless crystals |
|
|
|
- DuPont
- Rohm & Haas
- hone Poulenc
|
|
- Nabasan
- Dithane D14
- Parzate
- Chem Bam
|
|
Usually supplied as an aqueous solution |
|
|
|
|
|
200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
Insoluble |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Acetone |
- |
Insoluble |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Methanol |
- |
Insoluble |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Xylene |
- |
Insoluble |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Ethyl acetate |
- |
|
Decomposes before melting |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.75 X 10-05 |
Calculated |
- |
|
-4.24 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
1.26 X 10-07 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low volatility |
|
1.62 X 10-13 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
3.5 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data suggests degradation is quite rapid ranging for 30hrs to 4 or more days depending on pH |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
Known groundwater metabolites |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
395 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5000 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 12.1 |
Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.24 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
0.0056 |
Daphnia magna |
High |
|
- |
- |
- |
|
0.17 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
2.4 |
Chlorella pyrenoidosa |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
395 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Harmful if swallowed |
|
|
|
IMDG Transport Hazard Class 6,1 |
|
Health: H302, H317, H335 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN2757 |
|
- |
|
- |
|
|
|
nabam |
|
nabame |
|
Nabam |
|
nabam |
|
nabam |
|
nabam |
|
- |
|
nabam |
|
- |
|
- |
|
- |
|
- |