Monuron |
(Also known as: chlorfenidim; CMU) |
Monuron is an obsolete herbicide. Moderately toxic to humans and a suspected carcinogen. Moderately soluble in water, volatile, persistent in soil and has a high potential to leach into groundwater. Moderately toxic to wildlife but expected to be safe for honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability
 Warning: Significant data are missing |
Ecotoxicity Low alert: Birds acute ecotoxicity: Low; Fish acute ecotoxicity: Low; Daphnia acute ecotoxicity: Low; Bees acute contact ecotoxicity: Low
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen
 Warning: Significant data are missing |
|
A herbicide used to control a wide range of annual and perennial broad-leaved weeds and grasses |
|
Soil sterilant; Annual and perennial grasses; Broad-leaf weeds |
|
Non-cropped areas; Aspargus; Cotton; Ornamental shrubs; Sugar beet |
|
- |
|
Considered obsolete but may be available in some countries |
|
circa 1952 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₉H₁₁CIN₂O |
|
CN(C)C(=O)NC1=CC=C(C=C1)Cl |
|
No data |
|
BMLIZLVNXIYGCK-UHFFFAOYSA-N |
|
InChI=1S/C9H11ClN2O/c1-12(2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
monuron |
- |
 |
|
Herbicide |
|
Phenylurea herbicide; Urea herbicide |
|
- |
|
- |
|
Synthetic |
|
Non-selective, systemic which inhibits photosynthesis |
|
150-68-5 |
|
205-766-1 |
|
99 |
|
035501 |
|
8800 |
|
006-042-00-6 |
|
198.65 |
|
N-(4-chlorophenyl)-N,N-dimethylurea |
|
3-(4-chlorophenyl)-1,1-dimethylurea |
|
N'-(4-chlorophenyl)-N,N-dimethylurea |
|
Chemical subject to PIC regulations; Potential groundwater contaminant |
|
- |
|
C2 |
|
5 |
|
Not applicable |
|
Not applicable |
|
- |
|
Solid |
|
|
|
|
|
|
|
|
|
Usually supplied as a wettable powder |
|
|
|
|
|
230 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.17 X 1001 |
Calculated |
- |
|
1.79 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
0.067 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
5.80 X 10-05 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
170 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately mobile |
|
150 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
4.07 |
Calculated |
High leachability |
|
|
1.44 X 1000 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
75 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1053 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5000 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 110 |
|
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
Lepomis macrochirus |
Low |
|
- |
- |
- |
|
> 106 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 0.02 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pseudokirchneriella subcapitata |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 63 |
Dunaliella tertiolecta |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1053 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Harmful if swallowed IARC Group 3 carcinogen |
|
|
|
No information available |
|
Health: H302, H351 Environment: H400, H410 |
|
Not classified: Obsolete |
|
- |
|
- |
|
- |
|
|
|
monuron |
|
monuron |
|
Monuron |
|
monuron |
|
monuron |
|
monuron |
|
monuron |
|
monuron |
|
- |
|
- |
|
monuron |
|
- |