Mexacarbate (Ref: ENT 25766) |
(Also known as: BRN 2216978 ; zectrane; OMS 639; mexicarbate; DowCo 139) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High; Bees acute unknown ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 Warning: Significant data are missing |
|
An obsolete insecticide used for the control of pests on turf and ornmentals. |
|
Slugs; Snails; Tussock moth |
|
Lawns; Sports greens; Turf; Ornamentals trees and shrubs |
|
- |
|
Considered obsolete but may be available in some countries |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₂H₁₈N₂O₂ |
|
CC1=CC(=CC(=C1N(C)C)C)OC(=O)NC |
|
- |
|
YNEVBPNZHBAYOA-UHFFFAOYSA-N |
|
InChI=1S/C12H18N2O2/c1-8-6-10(16-12(15)13-3)7-9(2)11(8)14(4)5/h6-7H,1-5H3,(H,13,15) |
|
Yes |
|
Insecticide,Molluscicide, Acaricide |
|
Carbamate insecticide; Phenyl methylcarbamate fungicide |
|
- |
|
- |
|
Synthetic |
|
Cholinesterase inhibitor. |
|
315-18-4 |
|
206-249-3 |
|
None allocated |
|
044201 |
|
9414 |
|
No data found |
|
222.28 |
|
4-(dimethylamino)-3,5-dimethylphenyl methylcarbamate |
|
4-dimethylamino-3,5-xylyl methylcarbamate |
|
4-(dimethylamino)-3,5-dimethylphenyl methylcarbamate |
|
Marine Pollutant |
|
- |
|
Not applicable |
|
Not applicable |
|
1A |
|
Not applicable |
|
- |
|
White crystalline solid |
|
|
|
- Dow Elance
- Dow Chemical Co.
|
|
|
|
- |
|
|
|
|
|
100 |
|
Moderate |
|
51000000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
|
85.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
3.63 X 1002 |
Calculated |
- |
|
2.56 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.08 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
10 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
8 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature values give DT₅₀ < 10 days |
|
|
3.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Green bean leaves, n=1 |
|
|
1.9 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 1.0-2.75, tree foliage, n=2 |
|
|
- |
- |
- |
|
- |
|
|
5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Moderately mobile |
|
300 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.38 |
Calculated |
Low leachability |
|
|
1.41 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
14.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 3.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Anas platyrhynchos |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 0.0477 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Apis mellifera |
High |
|
- |
- |
- |
|
0.302 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
- |
- |
- |
|
|
1.06 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus terricola |
Moderate |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
0.055 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
High |
|
Contact |
|
|
0.055 |
R4 R = Peer reviewed scientific publications 4 = Verified data Andrena erythronii |
High |
|
Contact |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 13.9 |
Oncorhynchus mykiss |
Moderate |
|
1.0 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Cyprinodon variegatus |
Moderate |
|
0.0018 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
14.0 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
High |
|
1500 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
May be absorbed through the skin |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Toxic if swallowed or in contact with skin |
|
|
|
Corrosive Not expected to autoignite; Not highly flammable IMDG Transport Hazard Class 6,1 |
|
Health: H300, H312 Environment: H400, H410 |
|
Not classified: Obsolete |
|
UN2757 |
|
- |
|
- |
|
|
|
mexacarbate |
|
mexacarbate |
|
Mexacarbat |
|
- |
|
- |
|
mexacarbato |
|
- |
|
meksakarbat |
|
- |
|
- |
|
- |
|
- |