Mevinphos (Ref: ENT 22374) |
(Also known as: phosdrin; duraphos; mevinox; phosdrine; menite) |
Mevinphos is a highly toxic organophosphate insecticide. Known to cause significant inhibition of cholinesterase (ChE) activity by all routes of exposure. Readily soluble in water, volatile, slow aquatic hydrolysis, rapidly degrades in soil. Whilst the molecule is potentially mobile, it would not be expected to leach into groundwater due to rapid soil degradation. Extremely toxic to aquatic invertebrates, birds and mammals. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Drainflow: Mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Endocrine distrupter; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
An insecticide and acaricide used to control a broad spectrum of sucking and chewing insects |
|
Aphids; Grasshoppers; Leafhoppers; Caterpillars; Spider mites; Cutworms |
|
Vegetables; Fruit; Field crops |
|
- |
|
Considered obsolete but may be available in some countries |
|
circa 1955 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Sweden |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
isomeric mixture of E- and Z- isomeric forms |
|
C₇H₁₃O₆P |
|
CC(=CC(=O)OC)OP(=O)(OC)OC |
|
C/C(=C\C(=O)OC)/OP(=O)(OC)OC |
|
GEPDYQSQVLXLEU-UHFFFAOYSA-N |
|
InChI=1S/C7H13O6P/c1-6(5-7(8)10-2)13-14(9,11-3)12-4/h5H,1-4H3/b6-5+ |
|
Yes |
|
Insecticide, Acaricide |
|
Organophosphate insecticide; Organophosphate acaricide |
|
- |
|
May contain sulfotep, N-nitrosamines, halogenated dibenzo-pi-dioxins, halogenated dibenzofurans & PCBs |
|
Synthetic |
|
Systemic with contact, stomach and respiratory action. Acetylcholinesterase (AChE) inhibitor. |
|
7786-34-7 |
|
26718-65-0(E)/338-45-4(Z) |
|
232-095-1 |
|
45 |
|
015801 |
|
5355863 |
|
015-020-00-5 |
|
224.1 |
|
- |
|
methyl (EZ)-3-(dimethoxyphosphinoyloxy)but-2-enoate |
|
methyl 3-((dimethoxyphosphinyl)oxy)-2-butenoate |
|
Severe Marine Pollutant; Subject to the provisions of the UK Poisons Act 1972 |
|
UK Statutory standard for the protection of aquatic life in freshwaters: 0.02 µg l⁻¹ |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Musca domestica, Myzus persicae, Panonychus ulmi, Plusia gamma, Tetranychus urticae, many others |
|
Colourless to pale yellow liquid |
|
|
|
- AMVAC Chemical Corp
- Huikwang Corp.
- Shell
- Kenogard
|
|
- Phosdrin
- Mevidrin
- Apavinphos
- Menite
- Duraphos
|
|
Usually available as a liquid or emulsifiable concentrate |
|
|
|
|
|
600000 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
High |
|
Miscible |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Acetone |
- |
|
21 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.34 X 1000 |
Calculated |
- |
|
0.127 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.24 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
6.30 X 10-06 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
1.2 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
3 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General studies: DT₅₀ 1-4 hrs aerobic conditions, 1-12 days anaerobic conditions (R3) |
|
|
0.77 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 0.38-1.4 days, 6 field & undercover grown crops, various matrices, n=6 |
|
|
0.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 0.5-0.7 days, 2 field crops, various matrices, n=2 |
|
|
27 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Slow |
|
- |
|
|
17 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
- |
|
21 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
5 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Mobile |
|
44 |
|
Other studies: 50.5-86.2 mL g⁻¹ (R3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.12 |
Calculated |
Low leachability |
|
|
2.51 X 10-03 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
3.5 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
|
4 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
- |
- |
|
- |
- |
- |
|
> 4.63 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Anas platyrhynchos |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
0.094 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
0.146 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
High |
|
Contact |
|
|
0.002 |
R4 R = Peer reviewed scientific publications 4 = Verified data Nomia melanderi |
High |
|
Contact |
|
- |
- |
- |
|
Moderately harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
- |
- |
- |
|
Harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
0.012 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
0.00016 |
Daphnia pulex |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 71 |
W2 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 2 = Unverified data of unknown source Unknown species |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
3.5 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
4.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
7.3 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
No unacceptable risks to bystanders identified |
|
Absorbed by the skin, inhalation and via the gastrointestinal tract - PPE/PPC essential |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
Hygroscopic IMDG Transport Hazard Class 6.1 |
|
Health: H300, H310 Environment: H400, H410 |
|
Ia (Extremely hazardous) |
|
UN3278 |
|
- |
|
Chemically stable under standard ambient conditions when stored appropriately |
|
|
|
mevinphos |
|
mévinphos |
|
Mevinphos |
|
mevinphos |
|
mevinfos |
|
mevinfos |
|
mevinphos |
|
mewinfos |
|
mevinfos |
|
- |
|
mevinfos |
|
- |