Methoxychlor (Ref: OMS 466) |
(Also known as: methoxychlore; dimethoxy-DT; dianisyl trichloroethane; ENT 1716; DMDT) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; Potential for particle bound transport: High
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High
 |
Human health High alert: Endocrine distrupter; Neurotoxicant
 |
|
An insecticide effective against a wide range of pests encountered in agricultural (crops and livestock), horticulture and domestic situations |
|
Flies, Mosquitoes; Cockroaches; Chiggers |
|
Liverstock pest control; Domestic gardens; Pet pest management |
|
- |
|
Current |
|
circa 1948 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A prochiral molecule |
|
C₁₆H₁₅Cl₃O₂ |
|
COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)C(Cl)(Cl)Cl |
|
- |
|
IAKOZHOLGAGEJT-UHFFFAOYSA-N |
|
InChI=1S/C16H15Cl3O2/c1-20-13-7-3-11(4-8-13)15(16(17,18)19)12-5-9-14(21-2)10-6-12/h3-10,15H,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
methoxychlor |
- |
 |
|
Insecticide, Veterinary substance |
|
Organochloride insecticide |
|
- |
|
- |
|
Synthetic |
|
Contact and stomach action. Central nervous stimulant, producing hyperactivity, convulsions and death. Sodium channel modulator. |
|
72-43-5 |
|
200-779-9 |
|
14 |
|
034001 |
|
4115 |
|
No data found |
|
345.65 |
|
- |
|
1,1,1-trichloro-2,2-bis(4-methoxyphenyl)ethane |
|
1,1'-(2,2,2-trichloroethylidene)bis(4-methoxybenzene) |
|
POP candidate; OSPAR pfa |
|
- |
|
Not applicable |
|
Not applicable |
|
3B |
|
Not applicable |
|
Ctenocephalides felis, Cydia pomonella, Euxoa ochrogaster, Haematobia irritans, Helicoverpa zea, many more |
|
Colourless crystalline solid |
|
|
|
|
|
- Double-M
- Chemform
- Moxie
- Marlate
|
|
Supplied in a variety of formulations including emulsifiable concentrates, wettable powders, flowables, seed treatments and aerosols |
|
|
|
|
|
0.1 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
440000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
50000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
700000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Trichloroethane |
- |
1333000 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Dichloromethane |
- |
|
87 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.76 X 1005 |
Calculated |
- |
|
5.83 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.41 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
0.08 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Low volatility |
|
2.00 X 10-02 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
120 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Persistent |
|
120 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
6.5 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Cherry leaves, n=1 |
|
|
1.8 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Collard leaves, n=1 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Non-mobile |
|
80000 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-1.88 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
High |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
1622 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source (Other literature values Log BCF range 2.8-4.1 (R3)) |
Threshold for concern |
|
Not available |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 6000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
200 |
- |
|
- |
- |
- |
|
> 2000 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 23.6 |
Apis mellifera |
Moderate |
|
5.0 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.052 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
0.00078 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
0.001 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
36.7 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Chironomus dilutus as 10d LC₅₀ |
Moderate |
|
- |
- |
- |
|
0.6 |
Scenedesmus quadricauda |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 6000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.1 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
Non-statutory WHO drinking water guideline 0.02 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Endocrine issues - Strong estrogenic effect Potential kidney & liver toxicant IARC Group 3 carcinogen |
|
|
|
Highly flammable and easily ignited by heat, sparks and flames IMDG Transport Hazard Class 6.1 |
|
Health: H302, H312, H332, H351, H371 Environment: H400 |
|
U (Unlikely to present an acute hazard) |
|
UN2761 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
methoxychlor |
|
methoxychlore |
|
Methoxychlor |
|
methoxychlor |
|
metossicloro |
|
metoxiclor |
|
- |
|
metoksychlor |
|
- |
|
- |
|
- |
|
- |