Methiozolin (Ref: MRC-01) |
(Also known as: metiozolin) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Moderately persistent
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Reproduction/development effects
 |
|
A herbicide for turf and particularly useful for control of annual bluegass (Poa annua). |
|
Annual bluegrass and other grass weeds |
|
Turf; Sports greens |
|
- |
|
Current |
|
2008; 2010 first registered in Korea |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Methiozolin is a chiral molecule occurring in the R- and S-forms. Commercially it is sold as a an isomeric herbicide. |
|
C₁₇H₁₇F₂NO₂S |
|
CC1=C(SC=C1)C2=NOC(C2)(C)COCC3=C(C=CC=C3F)F |
|
No data |
|
OPEJGICLTMWFNQ-UHFFFAOYSA-N |
|
InChI=1S/C17H17F2NO2S/c1-11-6-7-23-16(11)15-8-17(2,22-20-15)10-21-9-12-13(18)4-3-5-14(12)19/h3-7H,8-10H2,1-2H3 |
|
Yes |
|
Herbicide |
|
Isoxazoline herbicide; Oxazole herbicide |
|
- |
|
- |
|
Synthetic |
|
Root uptake, slow acting, strongly inhibits plant cell wall biosynthesis in susceptible grasses |
|
403640-27-7 |
|
No data found |
|
None allocated |
|
- |
|
11500973 |
|
No data found |
|
337.38 |
|
rac-(5R)-5-{[(2,6-difluorophenyl)methoxy]methyl}-5-methyl-3-(3-methylthiophen-2-yl)-4,5-dihydro-1,2-oxazole |
|
(5RS)-5-[(2,6-difluorobenzyloxy)methyl]-4,5-dihydro-5-methyl-3-(3-methyl-2-thienyl)-1,2-oxazole |
|
5-[[(2,6-difluorophenyl)methoxy]methyl]-4,5-dihydro-5-methyl-3-(3-methyl-2-thienyl)isoxazole |
|
- |
|
- |
|
Q |
|
30 |
|
Not applicable |
|
Not applicable |
|
None identified |
|
- |
|
|
|
|
|
|
|
Usually supplied as an emulsifiable concentrate |
|
|
|
|
|
3.4 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
1000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Acetone |
- |
560 |
R4 R = Peer reviewed scientific publications 4 = Verified data Methanol |
- |
26 |
R4 R = Peer reviewed scientific publications 4 = Verified data Hexane |
- |
|
50.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
402.7 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
197.4 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
49 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
DT₅₀ range 46.8 to 51.7 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2500 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Eisenia foetida |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
|
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
1.53 |
R4 R = Peer reviewed scientific publications 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
2.04 |
R4 R = Peer reviewed scientific publications 4 = Verified data Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
2.88 |
R4 R = Peer reviewed scientific publications 4 = Verified data Selenastrum capricornutum |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2500 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
2500 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
- |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
methiozolin |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |