Methidathion (Ref: ENT 27193 ) |
(Also known as: OMS 844) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High; Earthworms acute ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
An insecticide and acaricide used to control a wide range of chewing and sucking pests |
|
Scales; Spider mites; Bollworm; Budworm; Lygus bugs; Whitefly |
|
Sunflower; Artichokes; Apples; Almonds; Cherries; Citrus; Sorghum; Cotton; Alfalfa |
|
- |
|
Current |
|
circa 1968 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Portugal |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₆H₁₁N₂O₄PS₃ |
|
COC1=NN(C(=O)S1)CSP(=S)(OC)OC |
|
No data |
|
MEBQXILRKZHVCX-UHFFFAOYSA-N |
|
InChI=1S/C6H11N2O4PS3/c1-10-5-7-8(6(9)16-5)4-15-13(14,11-2)12-3/h4H2,1-3H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
methidathion |
- |
 |
|
Insecticide, Acaricide |
|
Organophosphate insecticide; Organothiophosphate inseticide; Organophosphate acaricide; Organothiophosphate acaricide |
|
- |
|
- |
|
Synthetic |
|
Non-systemic with contact and stomach action. Cholinesterase inhibitor. |
|
950-37-8 |
|
213-449-4 |
|
193 |
|
100301 |
|
13709 |
|
015-069-00-2 |
|
302.3 |
|
- |
|
3-dimethoxyphosphinothioylthiomethyl-5-methoxy-1,3,4-thiadiazol-2(3H)-one |
|
S-((5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl) O,O-dimethyl phosphorodithioate |
|
Marine Pollutant; Chemical subject to PIC regulations; Subject to the provisions of the UK Poisons Act 1972 |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Aedes nigromaculis, Aphis gossypii, Bemisia tabaci, Meligethes aeneus, Myzus persicae, Plutella xylostella, many more |
|
Colourless crystals |
|
|
|
- King Tech Corp
- Makhteshim Agan
- Syngenta
- Ciba Geigy
|
|
- Cobra
- Cobracide
- Suprathion
- Supracide
- Ultracid
- Ultracide
|
|
Usually supplied as an emulsifiable concentrate or wettable powder |
|
|
|
|
|
240 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderate |
|
150000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
670000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
11000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
14000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Octanol |
- |
|
39.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
3.72 X 1002 |
Calculated |
- |
|
2.57 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.51 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
0.25 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
3.30 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
7 |
X3 X = WINPST database (click here ) 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Lab and field studies DT₅₀ range 3-18 days |
|
|
5.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 0.45-11.36 days, 6 field & undercover grown crops, various matrices, n=7 |
|
|
6.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 1.5-12.6 days, 3 field & undercover grown crops, various matrices, n=5; Grapes in cold storage RL₅₀=64 days. |
|
|
14 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Slow |
|
- |
|
|
27 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
- |
|
70 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
|
6 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Moderately mobile |
|
400 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.18 |
Calculated |
Low leachability |
|
|
9.23 X 10-03 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
12.6 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
25 |
Rat |
High |
|
|
0.2 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
4 |
- |
|
- |
- |
- |
|
23.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
High |
|
- |
- |
- |
|
- |
- |
- |
|
5.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 0.13 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data Apis mellifera |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
Harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
- |
- |
- |
|
Harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
0.01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
0.0064 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 22 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scenedesmus subspicatus |
Low |
|
> 0.2 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Chlorella pyrenoidosa |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
25 |
Rat |
High |
|
200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
0.14 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
0.001 |
|
- |
|
0.01 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
May be absorbed through the skin |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Possible nervous system, liver, gall bladder and ovaries toxicant USEPA - possible human carcinogen |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
Health: H300, H302 Environment: H400, H410 |
|
Ib (Highly hazardous) |
|
UN2783 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
methidathion |
|
methidathion |
|
Methidathion |
|
methidathion |
|
metidation |
|
metidation |
|
methidathion |
|
metydation |
|
- |
|
- |
|
methidathion |
|
- |