Mefenpyr diethyl (Ref: HOE 107892) |
(Also known as: mefenpyr-diethyl; AE F107892; AEF 107892) |
Mefenpyr diethyl is a herbicide safener with no herbicidal activity. It has a low aqueous solubility, is relatively volatile and a low potential for groundwater leaching. It is non-persistent in soil and moderately persistent in aquatic systems. it is not highly toxic to mammals and no serious human health issues have been reported although it is an irritant. It is moderately toxic to birds, earthworms and most aquatic organisms. It is not toxic to honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
A herbicide safener used with fenoxaprop-P-ethyl and iodosulfuron for selective weed control in cereals |
|
Current |
|
- |
|
Approved |
|
31/12/2030 |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable - not a ppp. May be authorised at national level under different legislation |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. The technical material is an isomeric mixture. |
|
C₁₆H₁₈Cl₂N₂O₄ |
|
CCOC(=O)C1=NN(C(C1)(C)C(=O)OCC)C2=C(C=C(C=C2)Cl)Cl |
|
No data |
|
OPGCOAPTHCZZIW-UHFFFAOYSA-N |
|
InChI=1S/C16H18Cl2N2O4/c1-4-23-14(21)12-9-16(3,15(22)24-5-2)20(19-12)13-7-6-10(17)8-11(13)18/h6-8H,4-5,9H2,1-3H3 |
|
Yes |
|
Other substance |
|
Herbicide safener |
|
Unclassified substance |
|
>940 g kg⁻¹ |
|
FAO: may potentially contain ethyl-2-chloro-2-(2,4-dichloro-phenylhydrazono)acetate as an inpurity |
|
Synthetic |
|
Enhances the metabolism of mesosulfuron-methyl and iodosulfuron-methyl |
|
135590-91-9 |
|
603-923-2 |
|
651.229 |
|
- |
|
- |
|
373.23 |
|
rac-diethyl (5R)-1-(2,4-dichlorophenyl)-5-methyl-4,5-dihydro-1H-pyrazole-3,5-dicarboxylate |
|
diethyl (RS)-1-(2,4-dichlorophenyl)-4,5-dihydro-5-methyl-1H-pyrazole-3,5-dicarboxylate |
|
diethyl 1-(2,4-dichlorophenyl)-4,5-dihydro-5-methyl-1H-pyrazole-3,5-dicarboxylate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
White to beige crystals |
|
|
|
|
|
- Aventis
- Bayer Crop Science
|
|
|
|
Available in a variety of formulations including oil in water emulsions, soluble concentrates and water dispersible granules. |
|
|
|
|
|
20 |
|
Low |
|
500000 |
Acetone |
- |
400000 |
Toluene |
- |
400000 |
Methanol |
- |
400000 |
Ethyl acetate |
- |
|
51 |
|
- |
|
- |
- |
- |
|
260 |
|
- |
|
- |
- |
- |
|
|
6.76 X 1003 |
Calculated |
- |
|
3.83 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.31 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
6.30 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
2.55 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
17.5 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
198 |
|
Stable |
|
- |
|
|
41 |
|
Moderately persistent |
|
- |
|
135 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Slow |
|
80 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
C3 C = AGRITOX dataset. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
634 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.49 |
Calculated |
Low leachability |
|
|
3.23 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
48 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
- |
- |
|
- |
- |
- |
|
> 2000 |
Coturnix japonica |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Eisenia foetida |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 700 |
Apis mellifera |
Low |
|
> 926 |
Apis mellifera |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
4.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
53 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
12 |
C3 C = AGRITOX dataset. Dataset is no longer available. 3 = Unverified data of known source Lemna gibba 7 day |
Low |
|
1.65 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Navicula pelliculosa |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
Rat |
Low |
|
4000 |
Rat |
- |
|
> 1.32 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
0.1 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data UK ACP 1997 |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.3 |
B4 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 4 = Verified data UK ACP 1997 |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
XNo, known not to cause a problem |
|
|
|
No further information available |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
- |
|
Not listed |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
mefenpyr diethyl |
|
- |
|
- |
|
- |
|
mefenpir-dietile |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |