Isofenphos-methyl |
(Also known as: methyl-isofenphos; methyl-isofenfos; isofenfos-methyl; methyl isp) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity High alert: Bees acute contact ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Mammals acute toxicity: High
 Warning: Significant data are missing |
|
An obsolete insecticide once used to control soil-dwelling insects |
|
White grubs, Cabbage root flies, Corn roundworms, Wireworms, Mole crickets |
|
Turf; Ornamental trees and shrubs; Corn; Maize; Carrots |
|
- |
|
Considered obsolete but may be available in some countries |
|
circa 1975 |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric |
|
C₁₄H₂₂NO₄PS |
|
CC(C)NP(=S)(OC)OC1=CC=CC=C1C(=O)OC(C)C |
|
- |
|
IXTOWLKEARFCCP-UHFFFAOYSA-N |
|
InChI=1S/C14H22NO4PS/c1-10(2)15-20(21,17-5)19-13-9-7-6-8-12(13)14(16)18-11(3)4/h6-11H,1-5H3,(H,15,21) |
|
Yes |
|
Insecticide |
|
Organophosphate insecticide; Phosporamidothioate insecticide |
|
- |
|
- |
|
Synthetic |
|
Selective with contact and stomach action. Acetylcholine esterase inhibitor. |
|
99675-03-3 |
|
635-465-4 |
|
412 |
|
- |
|
127394 |
|
No data found |
|
331.37 |
|
propan-2-yl 2-{[(E)-P-methoxy-N-propan-2-ylphosphoramidothioyl]oxy}benzoate |
|
isopropyl (RS)-O-[(isopropylamino)methoxyphosphinothioyl]salicylate |
|
1-methylethyl 2-[[methoxy[(1-methylethyl)amino]phosphinothioyl]oxy]benzoate |
|
Marine Pollutant |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
- |
|
Colourless to yellow oily liquid |
|
|
|
|
|
- |
|
- Obsolete - not thought to be commercially available for crop protection applications
|
|
- |
|
|
|
|
|
24 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
- |
- |
- |
|
Not applicable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
21.52 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 404 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 0.61 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
21.52 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
May be absorbed through the skin |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
Toxic in contact with skin or if swallowed |
|
|
|
No information available |
|
- |
|
Not classified: Obsolete |
|
- |
|
- |
|
- |
|
|
|
isofenphos-methyl |
|
isophenphos-methyle |
|
Isofenphos-methyl |
|
isofenphos-methyl |
|
isofenfos-metile |
|
isofenfos-metil |
|
isofenphos-methyl |
|
izofenfos metylowy |
|
- |
|
- |
|
isofenfos-methyl |
|
- |