Isocarbophos (Ref: BAY 93820) |
(Also known as: isocarbofos; optunal) |
Isocarbophos is an organophosphate insecticide. It has a moderate level of water solubility. Little is known regarding its environmental fate. It is highly toxic to mammals and also has a high potential for bioaccumulation. It is an acetyl cholinesterase inhibitor and a neurotoxin. It shows a high level of toxicity to birds. There is little information on its toxicity to other species. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 Warning: Significant data are missing |
|
A broad-spectrum insecticide used to control a variety of leaf-eating and soil insects on rice, fruit and other crops |
|
Aphids, Spider mite, Borers, leaf rollers |
|
Rice; Cotton; Fruit including apples, pears and other fruit trees |
|
- |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule with two steroisomers: S- and R-isocarbophos |
|
C₁₁H₁₆NO₄PS |
|
CC(C)OC(=O)C1=CC=CC=C1OP(=S)(N)OC |
|
No data |
|
YFVOXLJXJBQDEF-UHFFFAOYSA-N |
|
InChI=1S/C11H16NO4PS/c1-8(2)15-11(13)9-6-4-5-7-10(9)16-17(12,18)14-3/h4-8H,1-3H3,(H2,12,18) |
|
Yes |
|
Acaricide, Insecticide |
|
Organophosphate insecticide; Organophosphate acaricide; Phosporamidothioate insecticide; Phosporamidothioate acaricide |
|
- |
|
- |
|
Synthetic |
|
Acetylcholinesterase (AChE) inhibitor. |
|
24353-61-5 |
|
246-192-1 |
|
None allocated |
|
574300 |
|
90479 |
|
No data found |
|
289.29 |
|
propan-2-yl 2-{[(?)-P-methoxyphosphoramidothioyl]oxy}benzoate |
|
(RS)-(O-2-isopropoxycarbonylphenyl O-methyl phosphoramidothioate) |
|
1-methylethyl 2-[[amino(methoxy)phosphinothioyl]oxy]benzoate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
IB |
|
Not applicable |
|
- |
|
Colourless crystalline flakes in purest form. Technical material can be pale yellow to dark from viscous liquid |
|
|
|
- FCC Ltd
- Shenzhen Qinfeng Pesticides Co. Ltd.
|
|
|
|
- |
|
|
|
|
|
70.1 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.01 X 1002 |
Calculated |
- |
|
2.7 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.28 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
2.6 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Published literature RL₅₀ range 2.0-3.17 days, leaves of 2 field grown crops, n=2 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately mobile |
|
190 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
|
isocarbophos phosphodiesterase |
- |
- |
- |
- |
isopropyl salicylate |
- |
- |
- |
- |
isopropyl salicylate esterase |
- |
- |
- |
- |
salicylate |
- |
- |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
50 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
0.75 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Unknown species |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
0.014 |
R4 R = Peer reviewed scientific publications 4 = Verified data Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
50 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
Chronic exposure may cause seizures, incontinence, respiratory depression and loss of consciousness |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
Health: H300, H311 |
|
Not listed |
|
UN2783 |
|
- |
|
- |
|
|
|
isocarbophos |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |