Imazapyr |
(Also known as: imazapyr acid) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Fish chronic ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
A herbicide for non-crop land applications which is particularly effective on hard-to-control perennial grasses |
|
Annual and perennial grasses, Broad-leaved weeds; Woody plants; Brambles; Brush |
|
Forestry; Wetland sites; Non-cropped areas |
|
- |
|
Current |
|
1985 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule existing in the S- and R-forms |
|
C₁₃H₁₅N₃O₃ |
|
CC(C)C1(C(=O)NC(=N1)C2=C(C=CC=N2)C(=O)O)C |
|
No data |
|
CLQMBPJKHLGMQK-UHFFFAOYSA-N |
|
InChI=1S/C13H15N3O3/c1-7(2)13(3)12(19)15-10(16-13)9-8(11(17)18)5-4-6-14-9/h4-7H,1-3H3,(H,17,18)(H,15,16,19) |
|
Yes |
|
Herbicide |
|
Imidazolinone herbicide |
|
- |
|
- |
|
Synthetic |
|
Non-selective, absorbed by foliage and rapidly translocated. Controls vegetation by interfering with an enzyme pathway. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS. |
|
81334-34-1 |
|
617-219-8 |
|
530 |
|
128821 |
|
54738 |
|
613-126-00-1 |
|
261.28 |
|
- |
|
2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]nicotinic acid |
|
2-(4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl)-3-pyridinecarboxylic acid |
|
- |
|
- |
|
B |
|
2 |
|
Not applicable |
|
Not applicable |
|
Lolium rigidum |
|
Off-white to tan coloured solid |
|
|
|
- Nomix-Chipman
- BASF
- Makhteshim Agan Group
|
|
- Arsenal
- Chopper
- Habitat
- Stalker
- Katrin
- Katrin Forestal
|
|
Usually supplied as an aqueous solution that contains a wetting agent |
|
|
|
|
|
9740 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
33900 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
9.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
105000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
1800 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
|
171 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.29 X 1000 |
Calculated |
- |
|
0.11 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.34 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
1.9 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
pKa(2) 3.6, pKa(3) 11.0 |
|
0.013 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
3.00 X 10-07 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
11 |
|
Non-persistent |
|
11 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
EU dossier lab studies DT₅₀ range 5.9-16.5 days; Other sources: DT₅₀ 90 days (DW4), 25-142 (F3) |
|
|
- |
- |
- |
|
- |
|
|
26.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Forest plant leaves, n=1 |
|
|
2.1 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
|
- |
|
|
30 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately persistent |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
1.23 |
|
Moderately mobile |
|
125 |
|
0.94 |
|
EU dossier Kf range 0.64-1.81; 1/n range 0.90-0.97; Other literature data Kf range 0.84-33,24 mL g⁻¹, Kfoc range 17.9-3022 mL.g, 1.n range 0.50-0.81, Soils=6 (R4) |
|
- |
|
|
|
|
|
1.98 |
Calculated |
Transition state |
|
|
4.02 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
2.54 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
10000 |
- |
|
- |
- |
- |
|
2150 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
133 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
Apis mellifera |
Low |
|
25 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Low |
|
43.1 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Oncorhynchus mykiss 28 day |
Low |
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Low |
|
> 97.1 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.024 |
Lemna gibba |
Moderate |
|
71 |
W2 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 2 = Unverified data of unknown source Unknown species |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
5.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Highly toxic |
|
|
|
Prevent generation of mists |
|
Health: H319 Environment: H412 |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
imazapyr |
|
imazapyr |
|
Imazapyr |
|
imazapyr |
|
imazapir |
|
imazapir |
|
imazapyr |
|
imazapyr |
|
imazapyr |
|
- |
|
imazapyr |
|
- |