Imazapic (Ref: AC 263222) |
(Also known as: imazamethapyr; imazameth; CL 263222) |
Imazapic is a selective pre- and post-emergent herbicide. It has a high aqueous solubility, is volatile and, based on its chemical properties, is moderately mobile and may leach to groundwater. It is may be persistent in soil systems but usually degrades quickly in aquatic systems via photolysis. It has a low mammalian toxicity and has a high potential for bioaccumulation. It has a low level of toxicity to birds but is more toxic to aquatic life and honey bees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; GUS: High leachability
 |
Ecotoxicity Moderate alert: Fish chronic ecotoxicity: Moderate
 |
Human health Low alert
 |
|
A selective herbicide used for both the pre- and post-emergent control of some grasses and broad-leaved weeds. |
|
Annual and perennial grasses and some broad-leaved weeds |
|
Peanuts; Rangeland; Non-cropped areas |
|
- |
|
Current |
|
1996 |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Imazapic is a molecule with one chiral centre. Substance is racemic. |
|
C₁₄H₁₇N₃O₃ |
|
CC1=CN=C(C(=C1)C(=O)O)C2=NC(C(=O)N2)(C)C(C)C |
|
- |
|
PVSGXWMWNRGTKE-UHFFFAOYSA-N |
|
InChI=1S/C14H17N3O3/c1-7(2)14(4)13(20)16-11(17-14)10-9(12(18)19)5-8(3)6-15-10/h5-7H,1-4H3,(H,18,19)(H,16,17,20) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
imazapic |
- |
 |
|
Herbicide |
|
Imidazolinone herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic, contact and residual activity, inhibiting the production of amino acids necessary for cell division and growth. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS. |
|
104098-48-8 |
|
No data found |
|
None allocated |
|
129041 |
|
91770 |
|
No data found |
|
275.30 |
|
rac-5-methyl-2-[(4R)-4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid |
|
2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]-5-methylnicotinic acid |
|
2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-methyl-3-pyridinecarboxylic acid |
|
- |
|
- |
|
B |
|
2 |
|
Not applicable |
|
Not applicable |
|
Amaranthus palmeri |
|
Pale tan coloured powder |
|
|
|
|
|
- BASF
- Makhteshim Agan Group
- Amercian Cyanamid
|
|
- Cadre
- Plateau
- Impose
- Panoramic
|
|
Often supplied as water dispersible granules |
|
|
|
|
|
2230 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
High |
|
18.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
|
205 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.47 X 1000 |
Calculated |
- |
|
0.393 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.31 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
2.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
Strong acid; pKa(2) 3.6; pKa(3) 11.1 |
|
0.01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
120 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Persistent |
|
- |
- |
- |
|
232 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature DT₅₀ values range 31-410 days. Main degradation route is microbial. |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
0.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Fast |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Moderately mobile |
|
137 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
4.41 |
Calculated |
High leachability |
|
|
2.32 X 1000 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2150 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100000 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
R4 R = Peer reviewed scientific publications 4 = Verified data Oncorhynchus mykiss |
Low |
|
10 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Danio rerio |
Moderate |
|
> 100 |
R4 R = Peer reviewed scientific publications 4 = Verified data Daphnia magna |
Low |
|
- |
- |
- |
|
> 97.7 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.051 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Pseudokirchneriella subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rabbit |
- |
|
> 4.83 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Rapidly excreted in urine and feces. |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
Environment: H400, H410 |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
imazapic |
|
- |
|
- |
|
- |
|
- |
|
imazapic |
|
- |
|
imazapik |
|
- |
|
- |
|
- |
|
- |