Icaridin (Ref: KBR 3023) |
(Also known as: icaradine; picaradin; propidine; autan; hydroethyl isobutyl piperidine carboxylate) |
Icaridin is an insect repellant. It has a high aquatic solubility and is volatile. Data is limited regarding its environmental persistence. It has a relatively low mammalian toxicity and a high potential to bioaccumulate. It is is not highly toxic to birds or fish. There are gaps in ecotoxicology and environmental fate data. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
An insect repellant used for both human and animal applications to control a broad spectrum of insect pests |
|
Biting flies, Mosquitoes, Ticks, fleas |
|
Humans; Livestock |
|
- |
|
Current |
|
2001, USA first registered; 1998, first available Europe |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A molecule with 2 chiral centres |
|
C₁₂H₂₃NO₃ |
|
CCC(C)OC(=O)N1CCCCC1CCO |
|
- |
|
QLHULAHOXSSASE-UHFFFAOYSA-N |
|
InChI=1S/C12H23NO3/c1-3-10(2)16-12(15)13-8-5-4-6-11(13)7-9-14/h10-11,14H,3-9H2,1-2H3 |
|
Yes |
|
Insecticide, Repellent, Veterinary substance |
|
Piperidine compound |
|
970 g kg⁻¹ |
|
None declared by manufacturer; Chemistry suggests sec-butyl chloroformate & sec-butyl carbonic anhydride |
|
Synthetic |
|
Topically applied, repellent. Odorant receptor. It has been proposed that icaridin may bind to odorant binding protein 1 (AgamOBP1). |
|
119515-38-7 |
|
423-210-8 |
|
740 |
|
070705 |
|
125098 |
|
No data found |
|
229.32 |
|
- |
|
(RS)-sec-butyl (RS)-2-(2-hydroxyethyl)piperidine-1-carboxylate |
|
1-methylpropyl 2-(2-hydroxyethyl)-1-piperidinecarboxylate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
UNM |
|
Not applicable |
|
- |
|
Colourless, odourless liquid |
|
|
|
|
|
|
|
Available in a variety of formulations including aerosol sprays, pump sprays and towelette wipes |
|
|
|
|
|
8200 |
|
High |
|
Miscible |
Propanol |
- |
Miscible |
Ethanol |
- |
|
-170 |
Freezing point |
- |
|
296 |
|
- |
|
- |
- |
- |
|
375 |
|
- |
|
|
1.70 X 1002 |
Calculated |
- |
|
2.23 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.04 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
Not applicable |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
- |
No dissociation |
|
0.034 |
|
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
|
Stable |
|
Stable under normal environmental conditions |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
V1 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 1 = Estimated data with little or no verification |
Moderately mobile |
|
389 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.8 |
Whole fish |
Low potential |
|
ND |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
2236 |
Rat |
Low |
|
|
100 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data Rat |
Moderate |
|
- |
- |
|
- |
- |
- |
|
> 5000 |
Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
173 |
Oncorhynchus mykiss |
Low |
|
50.1 |
Oncorhynchus mykiss |
Low |
|
100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Daphnia magna |
Moderate |
|
103 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
71.5 |
Scenedesmus subspicatus |
Low |
|
54.8 |
Scenedesmus subspicatus |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
2236 |
Rat |
Low |
|
5000 |
Rat |
- |
|
> 4.36 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Occupational exposure may occur through inhalation and dermal contact |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
Not explosive or oxidising |
|
Not classified: Obsolete |
|
III (Slightly hazardous) |
|
- |
|
- |
|
- |
|
|
|
icaridin |
|
icaridin |
|
Icaridin |
|
icaridin |
|
icaridin |
|
icaridin |
|
- |
|
ikarydyna |
|
icaridin |
|
- |
|
- |
|
- |