Fluridone |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
A broad spectrum herbicide for use to control submerged and emerged aquatic weeds as well as on land |
|
Invasive plants including hydrilla, watermilfoil (Myriophyllum spp.), fanwort (Cabomba caroliniana), parrot feather (Myriophyllum brasiliense), pondweed (Potamogeton spp.); Barnyardgrass, Bermudagrass, Blackgrass, Cocklebur, Crabgrass, Foxtails, Nightshade, morning glory |
|
Surface water; Cotton; Fruit including avocado, citrus; Cucurbits; Grain crops; Vegetable root crops |
|
- |
|
Current |
|
1977 discovered; 1986 first registered USA |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₉H₁₄F₃NO |
|
CN1C=C(C(=O)C(=C1)C2=CC(=CC=C2)C(F)(F)F)C3=CC=CC=C3 |
|
No data |
|
YWBVHLJPRPCRSD-UHFFFAOYSA-N |
|
InChI=1S/C19H14F3NO/c1-23-11-16(13-6-3-2-4-7-13)18(24)17(12-23)14-8-5-9-15(10-14)19(20,21)22/h2-12H,1H3 |
|
Yes |
|
Herbicide |
|
Diphenyl heterocycle herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic, absorbed mainly by roots. Bleaching: inhibition of carotenoid biosynthesis. |
|
59756-60-4 |
|
261-916-6 |
|
None allocated |
|
112900 |
|
43079 |
|
No data found |
|
329.32 |
|
- |
|
1-methyl-3-phenyl-5-(α,α,α-trifluoro-m-tolyl)-4-pyridone |
|
1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]-4(1H)-pyridinone |
|
Highly phyto-toxic |
|
- |
|
F1 |
|
12 |
|
Not applicable |
|
Not applicable |
|
- |
|
White crystalline solid |
|
|
|
|
|
- Sonar
- Avast
- Whitecap
- Brake
- Pride
|
|
Usually supplied as an aqueous suspension or in a pelleted formulation |
|
|
|
|
|
12.3 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Chloroform |
- |
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
154.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
7.41 X 1001 |
Calculated |
- |
|
1.87 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.36 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
12.3 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
Very weak acid |
|
0.013 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
3.57 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
21 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately fast |
|
Degrades in UV light |
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
Stable pH 3 to pH 9 |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
DW3 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
1000 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.32 |
Calculated |
Low leachability |
|
|
2.77 X 10-02 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
65 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
150 |
- |
|
- |
- |
- |
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
102.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
> 363 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 11.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
> 6.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
4.9 |
<>Anabaena cylindrica |
Moderate |
|
0.41 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Chlamydomonas reinhardtii |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
4.12 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
Health: H311, H319 Environment: H411 |
|
U (Unlikely to present an acute hazard) |
|
UN2811 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
fluridone |
|
fluridone |
|
Fluridone |
|
fluridon |
|
fluridone |
|
fluridona |
|
- |
|
fluridon |
|
- |
|
- |
|
- |
|
- |