Fluoroacetamide |
(Also known as: monofluoroacetamide) |
Fluoroacetamide is a insecticide and rodenticide. It is highly soluble in water and highly volatile. It is highly toxic to mammals and has a high potential for bio-concentration. It is a neurotoxin and may cause adverse reproduction/development effects. Fluoroacetamide is highly toxic to bids and moderately toxic to fish. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Drainflow: Very mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Mammals acute toxicity: High; Reproduction/development effects; Neurotoxicant
 |
|
An unclassified rodenticide and insecticide |
|
Rats, Mice, Scale insects, Aphids and Mites |
|
As an insecticide: Fruit |
|
- |
|
Banned in many countries |
|
circa 1960 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Hungary |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₂H₄FNO |
|
C(C(=O)N)F |
|
No data |
|
FVTWJXMFYOXOKK-UHFFFAOYSA-N |
|
InChI=1S/C2H4FNO/c3-1-2(4)5/h1H2,(H2,4,5)/f/h4H2 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
fluoroacetamide |
- |
 |
|
Rodenticide, Insecticide |
|
Halogenated alkanoic acid rodenticide; Halogenated alkanoic acid insecticide |
|
- |
|
- |
|
Synthetic |
|
Once ingested converts to fluoroacetic acid causing the accumulation of fluoroacetic acid which inhibits the krebs cycle. Systemic. |
|
640-19-7 |
|
211-363-1 |
|
254 |
|
075002 |
|
12542 |
|
616-002-00-5 |
|
77.06 |
|
- |
|
2-fluoroacetamide |
|
2-fluoroacetamide |
|
Chemical subject to PIC regulations; Rotterdam Convention (Class Ib); Subject to the provisions of the UK Poisons Act 1972 |
|
- |
|
Not applicable |
|
Not applicable |
|
Not known |
|
Not applicable |
|
- |
|
Colourless crystalline powder |
|
|
|
|
|
1000000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
High |
|
- |
- |
- |
|
108 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
8.91 X 10-02 |
Calculated |
- |
|
-1.05 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.14 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
132100 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Highly volatile |
|
2.26 X 10-03 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Very mobile |
|
5 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
13 |
Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
13 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Phasianidae |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
40 |
Carassius auratus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
13 |
Rat |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
Possible contact via laid rodent bait |
|
May be absorbed via dermal routes |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
Extremely toxic May cause convulsions, nausea and vomiting Cardiovascular, Kidney & brain toxin |
|
|
|
Prevent generation of dust IMDG Transport Hazard Class 6.1 |
|
Health: H300, H311 |
|
Ib (Highly hazardous) |
|
UN2811 |
|
Packaging Group I (great danger) |
|
- |
|
|
|
fluoroacetamide |
|
fluoroacétamide |
|
Fluoracetamid |
|
fluoroacetamid |
|
fluoroacetamide |
|
fluroacetamida |
|
- |
|
fluoroacetamid |
|
- |
|
- |
|
fluoraceetamide |
|
- |