Ethyl-DDD |
(Also known as: ethylan; p,p'-ethyl-ddd; perthane) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity High alert: Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 |
Human health High alert: Carcinogen; Reproduction/development effects
 Warning: Significant data are missing |
|
An obsolete multi-use insecticide used mainly for domestic moth control and for moths and carpet beetles but had minor uses for insect control on fruit and vegetables |
|
Pear psylla; Leaf hoppers; Moths; Carpet beetles |
|
Pears; Tree fruit; Vegetables; Carpet & textile industry; Domestic use |
|
- |
|
Considered obsolete but may be available in some countries |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₈H₂₀Cl₂ |
|
CCC1=CC=C(C=C1)C(C2=CC=C(C=C2)CC)C(Cl)Cl |
|
- |
|
QFMDFTQOJHFVNR-UHFFFAOYSA-N |
|
InChI=1S/C18H20Cl2/c1-3-13-5-9-15(10-6-13)17(18(19)20)16-11-7-14(4-2)8-12-16/h5-12,17-18H,3-4H2,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
ethyl-DDD |
- |
 |
|
Insecticide |
|
Organochloride insecticide |
|
>88% |
|
- |
|
Synthetic |
|
Contact action |
|
72-56-0 |
|
200-785-1 |
|
None allocated |
|
032101 |
|
6295 |
|
No data found |
|
307.25 |
|
1,1-dichloro-2,2-bis(4-ethylphenyl)ethane |
|
1,1-dichloro-2,2-bis(4-ethylphenyl)ethane |
|
1,1-(2,2-dichloroethylidene)bis(4-ethylbenzene) |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
2A |
|
Not applicable |
|
- |
|
Cystalline solid |
|
|
|
|
|
|
|
Usually formulated as an emulsifiable liquid |
|
|
|
|
|
0.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
60 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes on distillation |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
52 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (start) |
- |
|
- |
- |
- |
|
|
4.57 X 1006 |
Calculated |
- |
|
6.66 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
8170 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5000 |
Coturnix japonica |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.016 |
Lepomis macrochirus |
High |
|
- |
- |
- |
|
0.018 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
8170 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
Intravenous LD₅₀ = 173 mg kg⁻¹ |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No information available |
|
|
|
Corrosive to some metals |
|
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
ethyl-DDD |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |