Ethion (Ref: ENT 24105) |
(Also known as: diethion; diéthion; dietion; FMC 1240; NIA 1240 ) |
Ethion is an organophosphate insecticide and acaricide which is not approved for use in the UK nor the EU. It has a low water solubility but is miscible with most organic solvents. It is moderately persistent in soils but can be persistent in water bodies under certain conditions. It is not mobile. Based on its physico-chemical parameters, ethion is not expected to leach to groundwater. It demonstrates a moderate to high level of toxicity for most species. There are concerns regarding its toxicity to humans being moderately toxic via the oral route, an acetyl cholinesterase inhibitor and neurotoxin. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; Potential for particle bound transport: High
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High
 |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
An insecticide and acaricide used to control a range of pests. Can also be a pesticide transformation product |
|
Red spidermite (Tetranychus urticae); Planthoppers; Aphids; Scale insects; Codling moth |
|
Fruit including apples, pears, citrus; Onions; Cotton; Cereals |
|
- |
|
Current |
|
1957, first reported |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
France |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₉H₂₂O₄P₂S₄ |
|
CCOP(=S)(OCC)SCSP(=S)(OCC)OCC |
|
No data |
|
RIZMRRKBZQXFOY-UHFFFAOYSA-N |
|
InChI=1S/C9H22O4P2S4/c1-5-10-14(16,11-6-2)18-9-19-15(17,12-7-3)13-8-4/h5-9H2,1-4H3 |
|
Yes |
|
Insecticide, Acaricide, Metabolite |
|
Soil |
|
Organophosphate insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
- |
|
- |
|
Synthetic |
|
Non-systemic with a predominate contact action. Acetylcholine esterase inhibitor. |
|
563-12-2 |
|
209-242-3 |
|
102 |
|
058401 |
|
3286 |
|
015-047-00-2 |
|
384.48 |
|
O,O,O',O'-tetraethyl S,S'-methylene bis(phosphorodithioate) |
|
O,O,O',O'-tetraethyl S,S'-methylene bis(phosphorodithioate) |
|
S,S'-methylene bis(O,O-diethyl phosphorodithioate) |
|
Severe Marine Pollutant; Chemical subject to PIC regulations |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Amblyseius fallacis, Delia antiqua, Musca domestica, Phytoseiulus persimilis, Boophilus microplus, many others |
|
Amber liquid |
|
|
|
- Bayer CropScience
- Cheminova
- King Tech Corp
- Hikal Ltd.
|
|
- Rhodocide
- Ethio
- Tefethion
- Ethiomobeed
- Nialate
- Hylemox
|
|
Available in a variety of formulations including dusts, emulsifiable concentrates and solutions, granules and wettable powders. |
|
|
|
|
|
2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
|
-12 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
165 |
|
- |
|
- |
- |
- |
|
176 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (closed cup) |
- |
|
|
1.17 X 1005 |
Calculated |
- |
|
5.07 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.22 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
0.2 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
3.85 X 10-02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
90 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
150 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Tropical soils DT₅₀ range 9-16 days, temperate sandy soils DT₅₀ 49-56 day, 168 days organic soils |
|
|
5.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 3.0-10.5 days, 5 field crops, various matrices, n=6 |
|
|
4.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 2.0-9.4 days, 7 field &crops, various matrices, n=9 |
|
|
- |
- |
- |
|
- |
|
|
146 |
|
Persistent |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Non-mobile |
|
10000 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.00 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
High |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
586 |
|
Threshold for concern |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
208 |
Rat |
Moderate |
|
|
0.3 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
6 |
- |
|
- |
- |
- |
|
128 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Phasianidae |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
11 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Moderate |
|
- |
- |
- |
|
20.6 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Harmful |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
0.5 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Salmonidae |
Moderate |
|
0.013 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas 33 day |
Moderate |
|
0.000056 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Unknown species |
High |
|
0.000025 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
208 |
Rat |
Moderate |
|
838 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
0.45 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
May be absorbed through the skin |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
Bioaccumulates |
|
|
|
Prevent generation of mists Use foam, carbon dioxide or dry chemicals to tackle fires May produce toxic gases in a fire IMDG Transport Hazard Class 6.1 |
|
Health: H301, H312 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN3018 |
|
- |
|
- |
|
|
|
ethion |
|
ethion |
|
Ethion |
|
ethion |
|
etion |
|
etion |
|
ethion |
|
etion |
|
- |
|
- |
|
ethion |
|
- |