Dioxathion (Ref: Hercules AC25) |
(Also known as: dioxation; delnav; dioxane phosphate; dioxationum) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 Warning: Significant data are missing |
|
Used as a livestock insecticide and as an acaricide on citrus fruits, deciduous fruits and nuts |
|
Ticks; Fleas; Lice; Mites including clover mites, spider mites; Thips; Apple maggots; Codling moth |
|
Fruit including citrus, quince, grapes, apples, pears; Walnuts; Ornamentals; Non-agricultural sites such as industrial areas, recreational land, dog kennels |
|
- |
|
Considered obsolete but may be available in some countries |
|
1959, first reported |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. The technical material is an isomeric mixture. |
|
C₁₂H₂₆O₆P₂S₄ |
|
CCOP(=S)(OCC)SC1C(OCCO1)SP(=S)(OCC)OCC |
|
No data |
|
VBKKVDGJXVOLNE-UHFFFAOYSA-N |
|
InChI=1S/C12H26O6P2S4/c1-5-15-19(21,16-6-2)23-11-12(14-10-9-13-11)24-20(22,17-7-3)18-8-4/h11-12H,5-10H2,1-4H3 |
|
Yes |
|
Insecticide, Acaricide, Veterinary substance |
|
Organophosphate insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
>68% |
|
- |
|
Synthetic |
|
Acetylcholinesterase (AChE) inhibitor. |
|
78-34-2 |
|
201-107-7 |
|
124 |
|
037801 |
|
6531 |
|
015-063-00-X |
|
456.54 |
|
O,O,O',O'-tetraethyl S,S'-1,4-dioxane-2,3-diyl bis(phosphorodithioate) |
|
S,S'-(1,4-dioxane-2,3-diyl) O,O,O',O'-tetraethyl bis(phosphorodithioate) |
|
S,S'-1,4-dioxane-2,3-diyl bis(O,O-diethyl phosphorodithioate) |
|
Marine Pollutant; Subject to the provisions of the UK Poisons Act 1972 |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Boophilus decoloratus, Panonychus citri, Rhipicephalus evertsi, Boophilus microplus, Rhipicephalus appendiculatus |
|
Reddish-brown liquid |
|
|
|
- Hercules
- Nor-Am Chemical Co.
|
|
|
|
Usually supplied as an emulsifiable concentrate |
|
|
|
|
|
1.55 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low |
|
20000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Kerosene |
- |
10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-hexane |
- |
|
-2 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.82 X 1003 |
Calculated |
- |
|
3.45 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.26 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
35 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature values give DT₅₀ range 15 (silty clay loam) - 55 days (clay) |
|
|
6.1 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Orange leaves, n=1 |
|
|
- |
- |
- |
|
- |
|
|
Stable |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Stable |
|
- |
|
|
Stable |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-mobile |
|
11845 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-0.11 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
23 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 3600 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 50 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.118 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
0.00035 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
23 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
235 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.0015 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
May be absorded through the skin - PPE/PPC required |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
May cause mild transient conjunctivitis Very toxic |
|
|
|
Prevent generation of mists |
|
Health: H300, H311, H330 Environment: H400, H410 |
|
Ib (Highly hazardous) |
|
- |
|
- |
|
- |
|
|
|
dioxathion |
|
dioxathion |
|
Dioxathion |
|
- |
|
- |
|
dioxation |
|
- |
|
dioksation |
|
- |
|
- |
|
- |
|
- |