Dinoseb (Ref: HOE 26150) |
(Also known as: DNBP; dinosebe; dinitro-general; DN 289) |
Dinoseb is a herbicide that was once widely used. It has a moderate aqueous solubility, is volatile and has a high potential for leaching to groundwater. It is not generally persistent in soil systems but can be persistent in water. It is highly toxic to mammals and may cause development/reproduction effects. Dinoseb is also a know irritant. It is highly toxic to birds, moderately toxic to fish but presents less of a risk to honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Fish chronic ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Reproduction/development effects
 |
|
An obsolete dinitrophenol herbicide that was used for post-emergence weed control in a variety of crops including cereals, vegetables and some soft fruit |
|
Crabgrass; Barnyardgrass; Pigweed; Lambsquarters; Foxtails; Sorrel |
|
Soybeans; Cereals; Cotton; Fruit including citrus, grapes, bluebrries, currants, gooseberries; Nuts; Lucerne |
|
- |
|
Considered obsolete but may be available in some countries; Banned in many countries |
|
1945, first reported |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. Substance is racemic. |
|
C₁₀H₁₂N₂O₅ |
|
CCC(C)C1=CC(=CC(=C1O)[N+](=O)[O-])[N+](=O)[O-] |
|
- |
|
OWZPCEFYPSAJFR-UHFFFAOYSA-N |
|
InChI=1S/C10H12N2O5/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17/h4-6,13H,3H2,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
dinoseb |
Unstated isomer |
 |
|
Herbicide |
|
Dinitrophenol herbicide |
|
>95% |
|
- |
|
Synthetic |
|
Contact. Inhibits respiratory electron transport and is an uncoupler of oxidative phosphorylation via disruption of proton gradient - membrane disruption. |
|
88-85-7 |
|
201-861-7 |
|
46 |
|
037505 |
|
6950 |
|
609-025-00-7 |
|
240.22 |
|
rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenol |
|
(RS)-2-sec-butyl-4,6-dinitrophenol |
|
2-(1-methylpropyl)-4,6-dinitrophenol |
|
Chemical subject to PIC regulations; Marine Pollutant; Rotterdam Convention (Class O); Subject to the provisions of the UK Poisons Act 1972 |
|
- |
|
M |
|
24 |
|
Not applicable |
|
Not applicable |
|
- |
|
Dark reddish brown solid or orange viscous liquid depending upon temperature |
|
|
|
|
|
- DowElanco
- Hoeschst
- Schering
|
|
- Aretit
- Ivosit
- Supersevtox
- Premerge
- Caldon: Chemox
- Subitex
- Nitrapone
|
|
Available in a variety of formulations including soluble liquids and emulsifiable concentrates. |
|
|
|
|
|
52 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Moderate |
|
480000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Ethanol |
- |
270000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
|
38 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
177 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
1.95 X 1002 |
Calculated |
- |
|
2.29 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.35 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
4.62 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
Weak acid |
|
6.7 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Moderately volatile |
|
6.01 X 10-04 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
18 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Non-persistent |
|
30 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature data indicates DT₅₀ of 2 to 6 weeks |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
T4 T = UN EPFA database. Dataset no longer available. 4 = Verified data |
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Mobile |
|
30 |
|
Other sources: 117-123 mL g⁻¹ (R3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
3.73 |
Calculated |
High leachability |
|
|
6.36 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
1.8 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Whole body |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
25 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
9.5 |
Anas platyrhynchos |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.044 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Salmonidae |
High |
|
0.059 |
Pimephales promelas 32 day |
Moderate |
|
0.24 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
0.170 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
1.201 |
Chlamydomonas moewusii 7 day |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
25 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Minimal risk at current time due to substance being obsolete |
|
Readily absorbed through the skin - PPE/PPC required |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Highly hazardous USEPA - possible human carcinogen |
|
|
|
An oxidising agent |
|
Health: H301, H311, H319, H360Df Environment: H400, H410 |
|
Ib (Highly hazardous) |
|
- |
|
- |
|
- |
|
|
|
dinoseb |
|
dinosèbe |
|
Dinoseb |
|
dinoseb |
|
dinoseb |
|
dinoseb |
|
dinoseb |
|
dinoseb |
|
- |
|
- |
|
dinoseb |
|
- |