Dinoseb sodium |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
Human health High alert: Reproduction/development effects
 |
|
An obsolete dinitrophenol herbicide that was used for post-emergence weed control in a variety of crops including cereals, vegetables and some soft fruit |
|
Crabgrass; Barnyardgrass; Pigweed; Lambsquarters; Foxtails; Sorrel |
|
Soybeans; Cereals; Cotton; Fruit including citrus, grapes, bluebrries, currants, gooseberries; Nuts; Lucerne |
|
- |
|
Considered obsolete but may be available in some countries; Banned in many countries |
|
1960, dinoseb first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Substance is racemic. |
|
C₁₀H₁₁N₂NaO₅ |
|
- |
|
- |
|
LRWSMDCIWRLZIX-UHFFFAOYSA-M |
|
InChI=1S/C10H12N2O5.Na/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17;/h4-6,13H,3H2,1-2H3;/q;+1/p-1 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
dinoseb |
Parent |
 |
|
Herbicide |
|
Dinitrophenol herbicide |
|
- |
|
- |
|
Synthetic |
|
Inhibits respiratory electron transport, and uncouples oxidative phosphorylation - membrane disruption. Selective, non-systemic. Contact action. |
|
35040-03-0 |
|
No data found |
|
46 |
|
- |
|
- |
|
609-025-00-7 |
|
262.19 |
|
sodium (RS)-2-sec-butyl-4,6-dinitrophenolate |
|
sodium (RS)-2-sec-butyl-4,6-dinitrophenolate |
|
2-(1-methylpropyl)-4,6-dinitrophenol sodium salt |
|
Chemical subject to PIC regulations; Marine Pollutant; Rotterdam Convention (Class O) |
|
- |
|
M |
|
24 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
- |
|
Available in a variety of formulations including emulsifiable concentrates and wettable powders |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Minimal risk due to substance being obsolete |
|
Readily absorbed through the skin - PPE/PPC required |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Highly toxic |
|
|
|
Incompatible with alkaline substances |
|
Health: H301, H311, H319, H360Df Environment: H400, H410 |
|
Ib (Highly hazardous) |
|
- |
|
- |
|
- |
|
|
|
dinoseb sodium |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |