Dimefluthrin |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
Ecotoxicity High alert: Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Neurotoxicant
 |
|
A pyrethroid insecticide that has strong activity against mosquitoes and other insect pests |
|
Mosquitoes; Flies; Cockroaches; Whitefiles |
|
Amenity and domestic buildings |
|
- |
|
Current |
|
2003 |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric mixture of the R- and S-forms of dimefluthrin |
|
C₁₉H₂₂F₄O₃ |
|
CC(=CC1C(C1(C)C)C(=O)OCC2=C(C(=C(C(=C2F)F)COC)F)F)C |
|
No data |
|
OOWCJRMYMAMSOH-UHFFFAOYSA-N |
|
InChI=1S/C19H22F4O3/c1-9(2)6-12-13(19(12,3)4)18(24)26-8-11-16(22)14(20)10(7-25-5)15(21)17(11)23/h6,12-13H,7-8H2,1-5H3 |
|
Yes |
|
Insecticide |
|
Pyrethroid insecticide; Pyrethroid ester insecticide |
|
>=95% |
|
- |
|
Synthetic |
|
Broad spectrum acting by contact and inhalation. Fast knockdown. |
|
271241-14-6 |
|
No data found |
|
None allocated |
|
- |
|
213011 |
|
No data found |
|
374.38 |
|
(2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl)methyl (1E,3E)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate |
|
2,3,5,6-tetrafluoro-4-(methoxymethyl)benzyl (1RS)-cis,trans-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
|
(2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl)methyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate |
|
Marine pollutant |
|
- |
|
Not applicable |
|
Not applicable |
|
Not known |
|
Not applicable |
|
- |
|
Pale yellow liquid with slight characteristic odour |
|
|
|
|
|
- Black mosquito coil
- Pi Wen Ling
|
|
Used within emanators, including pesticide mats and coils, for consumer products |
|
|
|
|
|
2.0 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low |
|
Miscible |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Acetone |
- |
Miscible |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Ethanol |
- |
Miscible |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source n-Hexane |
- |
|
- |
- |
- |
|
134 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
197 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source (open cup) |
- |
|
|
2.51 X 1005 |
Calculated |
- |
|
5.4 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.18 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
0.91 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
2270 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.004 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Oryzias latipes |
High |
|
- |
- |
- |
|
0.0017 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
2270 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
Low |
|
2000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
- |
|
1.06 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat 2 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Exposure may cause headache, dizziness, nausea, fluid in lungs, running nose and convulsions Possible liver toxicant Toxic if inhaled |
|
|
|
Combustible Incompatible with strong oxidising agents, acids and bases Will emit toxic biproducts if heated to decomposition |
|
Health: H331, H303, H313, H370, H373 Environment: H400, H410 |
|
- |
|
- |
|
- |
|
- |
|
|
|
dimefluthrin |
|
dimefluthrin |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |