Diflovidazin (Ref: SZ1 121) |
(Also known as: diflovidazin; flufenzine; diflondazin) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Reproduction/development effects
 Warning: Significant data are missing |
|
A tetrazine selective miticide used against a wide range of mites |
|
Wide range of mites including, for example, those from the families Tetranychidae, Eriophyidae, Tarsonemidae and Tenuipalpidae, Tetranychus urticae, Colomerus vitis, Calepitrimerus vitis |
|
Cotton; Horticulture; Viticulture |
|
- |
|
- |
|
1997 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₄H₇ClF₂N₄ |
|
C1=CC=C(C(=C1)C2=NN=C(N=N2)C3=C(C=CC=C3F)F)Cl |
|
- |
|
SWBHWUYHHJCADA-UHFFFAOYSA-N |
|
InChI=1S/C14H7ClF2N4/c15-9-5-2-1-4-8(9)13-18-20-14(21-19-13)12-10(16)6-3-7-11(12)17/h1-7H |
|
Yes |
|
Insecticide, Acaricide |
|
Tetrazine insecticide; Tetrazine acaricide |
|
- |
|
- |
|
Synthetic |
|
Contact, ovicide, selective with translaminar activity. Mite growth inhibitor affecting CHS1. |
|
162320-67-4 |
|
605-284-5 |
|
734 |
|
- |
|
153985 |
|
No data found |
|
304.69 |
|
- |
|
3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine |
|
1,2,4,5-tetrazine, 3-(2-chlorophenyl)-6-(2,6-difluorophenyl) |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
10A |
|
Not applicable |
|
- |
|
Magenta coloured crystals |
|
|
|
|
|
|
|
Usually formulated as a suspension concentrate |
|
|
|
|
|
0.23 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low |
|
24000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
1300 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
16800 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
188 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
211 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
190 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
- |
|
425 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (closed cup) |
- |
|
|
5.01 X 1003 |
Calculated |
- |
|
3.7 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.57 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Not applicable |
|
- |
No dissociation |
|
0.01 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
73 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature data DT₅₀ range 30-44 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
Stable pH 1 to pH 7, DT₅₀ 2.5 days at pH 9, all at 25 °C |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately mobile |
|
476 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
2.46 |
Calculated |
Transition state |
|
|
1.52 X 10-01 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
594 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
2000 |
Coturnix japonica |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
1000 |
Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
25.0 |
Apis mellifera |
Moderate |
|
25.0 |
Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
400 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Oncorhynchus mykiss |
Low |
|
- |
- |
- |
|
0.14 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
594 |
Rat |
Moderate |
|
2000 |
Rat |
- |
|
5.0 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
Health: H302, H319 Environment: H400 |
|
Not listed |
|
- |
|
- |
|
- |
|
|
|
diflovidazin |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |