Dienochlor (Ref: SAN 804) |
(Also known as: decachlor; dienochlore; HRS 1654; HRS 16A) |
Dienochlor is an obsolete organochlorine insecticide. It has a low aqueous solubility and is quite volatile. Its data suggests it is persistent in soils. It is not toxic to mammals but does high a potential for bioaccumulation. Dienochlor has a moderate toxicity to aquatic invertebrates but considered to be more toxic to fish. It is relatively non-toxic to birds |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 Warning: Significant data are missing |
Ecotoxicity High alert: Fish acute ecotoxicity: High
 |
Human health Low alert
 |
|
An obsolete insecticide once used to control of plant-damaging mites on ornamentals |
|
Various mites including two-spotted spider, tumid spider, strawberry spider, spruce spider, citrus red, European red, carmine, clover, McDaniel mite and the privet mite |
|
Ornamental shrubs and trees outside and within greenhouses |
|
- |
|
Considered obsolete but may be available in some countries |
|
1964, first reported |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₀Cl₁₀ |
|
C1(=C(C(C(=C1Cl)Cl)(C2(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl)Cl)Cl)Cl |
|
No data |
|
LWLJUMBEZJHXHV-UHFFFAOYSA-N |
|
InChI=1S/C10Cl10/c11-1-2(12)6(16)9(19,5(1)15)10(20)7(17)3(13)4(14)8(10)18 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
dienochlor |
- |
 |
|
Acaricide, Insecticide, Ovicide |
|
Organochloride insecticide; Organochloride acaricide |
|
- |
|
- |
|
Synthetic |
|
Contact action, destabilises nerve cell membranes. GABA-gated chloride channel antagonist. |
|
2227-17-0 |
|
218-763-5 |
|
None allocated |
|
027501 |
|
16686 |
|
No data found |
|
474.8 |
|
1,1',2,2',3,3',4,4',5,5'-decachlorobi(cyclopenta-2,4-diene) |
|
perchloro-1,1'-bicyclopenta-2,4-diene |
|
1,1',2,2',3,3',4,4',5,5'-decachlorobi-2,4-cyclopentadien-1-yl |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
2A |
|
Not applicable |
|
Tetranychus urticae |
|
Colourless to grey coloured crystalline solid |
|
|
|
- Novartis
- Dow
- Hooker: Zoecon
|
|
|
|
Usually supplied as a wettable powder or as flowable concentrates |
|
|
|
|
|
0.025 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
590000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
47700 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Octanol |
- |
|
122 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
6.92 X 1003 |
Calculated |
- |
|
3.84 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
1.94 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
1.3 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Low volatility |
|
69.3 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
300 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Slightly mobile |
|
783 |
|
Literature range 196-1000 mL g⁻¹ |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
2.74 |
Calculated |
Transition state |
|
|
2.35 X 10-01 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
|
2700000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
High potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 3160 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Rat |
Low |
|
|
6.3 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Rat |
High |
|
- |
- |
|
- |
- |
- |
|
3966 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 36.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.05 |
Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
1.2 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 3160 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Rat |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
Low risk to Europeans as no longer approved for use |
|
Low risk to Europeans as no longer approved for use |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
Health: H302, H319 Environment: H400 |
|
III (Slightly hazardous) |
|
UN2761 |
|
- |
|
- |
|
|
|
dienochlor |
|
dienochlore |
|
Dienochlor |
|
dienochlor |
|
dienoclor |
|
dienoclor |
|
- |
|
dienochlor |
|
- |
|
- |
|
- |
|
- |