Diclofop (Ref: AE F021079) |
(Also known as: diclofop acid; diclofop free acid; HOE 021079) |
Diclofop is a grass herbicide which is usually used as the methyl variant. It is highly soluble in water and is not considered to be volatile. It is not normally environmentally persistent. Diclofop is moderately toxic to mammals via the oral route. Its toxicity to biodiversity tends to be moderate to low. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Moderately persistent; GUS: Transition state; Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate; Earthworms chronic ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen; Possible Reproduction/development effects
 |
|
Post-emergence herbicide usually used as the methyl variant. Also a pesticide transformation product |
|
Wild oats; Crowsfoot grass; Annual ryegrass; Common barbgrass |
|
Vegetables including brassicas, beans, carrots, peas, parsnips, onions; Sugarbeet; Cereals including barley, wheat; Oilseed rape; Potatoes |
|
- |
|
Current |
|
circa 1982 |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Portugal/France |
|
31/05/2023 |
|
Yes - low ADI / ARfD / AOEL |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
✓ |
|
|
|
|
|
|
|
|
A chiral molecule. Substance is racemic. |
|
C₁₅H₁₂Cl₂O₄ |
|
CC(C(=O)O)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)Cl |
|
- |
|
OOLBCHYXZDXLDS-UHFFFAOYSA-N |
|
InChI=1S/C15H12Cl2O4/c1-9(15(18)19)20-11-3-5-12(6-4-11)21-14-7-2-10(16)8-13(14)17/h2-9H,1H3,(H,18,19) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Herbicide, Metabolite |
|
Soil |
|
Aryloxyphenoxypropionate herbicide |
|
930 g kg⁻¹ |
|
EU dossier - None declared |
|
Synthetic |
|
Selective, absorbed by leaves and inhibits fatty acid synthesis. Inhibition of acetyl CoA carboxylase (ACCase) |
|
40843-25-2 |
|
No data found |
|
358 |
|
110902 |
|
38687 |
|
607-165-00-3 |
|
327.16 |
|
rac-(2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid |
|
(RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionic acid |
|
2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid |
|
- |
|
- |
|
A |
|
1 |
|
Not applicable |
|
Not applicable |
|
- |
|
Pale yellow solid |
|
|
|
|
|
- Bayer CropScience
- Bayer Environmental
|
|
- Hoe-Grass
- Hoelon 3EC
- Illoxan
- One-shot
|
|
Usually supplied as an emulsion that is mixed with water and used as a spray |
|
|
|
|
|
122700 |
|
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
4.07 X 1001 |
Calculated |
- |
|
1.61 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
3.43 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
Weak acid |
|
2.5 X 10-03 |
|
Low volatility |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
24 |
|
Non-persistent |
|
23.9 |
|
Non-persistent |
|
35.2 |
|
Moderately persistent |
|
84.7 |
|
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
EU dossier lab studies DT₅₀ range 5.1-74.0 days, DT₉₀ range 23.3-246 days, Field studies DT₅₀ range 25.7-52.2 days ; General literature DT₅₀ range 10 days (sand) - 30 days (sandy clay) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
58.3 |
|
Moderately fast |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
6.3 |
|
Moderately mobile |
|
289 |
|
0.882 |
|
EU dossier kf range 0.76-13.54 mL g⁻¹, kfoc range 148-505.5 mL g⁻¹, 1/n range 0.819-0.913, Soils=6 |
|
Yes |
|
|
|
|
|
2.38 |
Calculated |
Transition state |
|
|
1.24 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
|
Low risk |
Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 586 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 10000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Phasianidae |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 500 |
Eisenia foetida corr |
Moderate |
|
50 |
Eisenia foetida corr |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
as methyl variant |
Low |
|
> 131 |
as methyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
Oncorhynchus mykiss |
Low |
|
16.0 |
Oncorhynchus mykiss |
Low |
|
48 |
Daphnia magna |
Moderate |
|
0.0156 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
10 |
Chironomus riparius |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
10.4 |
Pseudokirchneriella subcapitata |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 586 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.001 |
|
- |
|
0.03 |
|
- |
|
- |
- |
- |
|
0.003 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Readily absorbed through the gastrointestinal tract |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
Kidney and liver toxicant |
|
|
|
Not explosive or oxidising |
|
Health: H302, H317 Environment: H400, H410 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
- |
|
|
|
diclofop |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
dichlofop |
|
- |
|
- |
|
- |
|
- |