Dichlorprop (Ref: RD 406) |
(Also known as: 2,4-DP) |
Dichlorprop is a post-emergence, selective herbicide. It has a moderate aqueous solubility and is volatile. Its data suggests it is not persistent in soils but may persist in some water systems. It is moderately toxic to. Dichlorprop has a moderate to low toxicity to most aquatic organisms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Reproduction/development effects
 Warning: Significant data are missing |
|
A herbicide for post-emergence control of annual and perennial broad-leaved weeds and some brush species |
|
Canada thistle; Cocklebur; Ragweeds; Pigweed; Shepherd's purse; Stinkweed; Lambsquarter; Goosefoot; Wild mustard |
|
Cereals including wheat, barley; Non-crop situations including right-of-way, commercial and industrial sites |
|
- |
|
Current |
|
1961 |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Chiral with S- and R- enantiomers. Substance is racemic. |
|
C₉H₈Cl₂O₃ |
|
CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl |
|
Clc1cc(Cl)ccc1OC(C(=O)O)C |
|
MZHCENGPTKEIGP-UHFFFAOYSA-N |
|
InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
Common Name |
Relationship |
Link |
dichlorprop |
- |
 |
|
Herbicide, Plant Growth Regulator |
|
Aryloxyalkanoic acid herbicide; Phenoxypropionic herbicde; Auxin PGR |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic, absorbed through leaves and translocates to roots. Synthetic auxin causing stem and leaf malformations leading to death. |
|
120-36-5 |
|
7547-66-2 |
|
204-390-5 |
|
84 |
|
031401 |
|
8427 |
|
607-045-00-0 |
|
235.06 |
|
rac-(2R)-2-(2,4-dichlorophenoxy)propanoic acid |
|
(RS)-2-(2,4-dichlorophenoxy)propionic acid |
|
2-(2,4-dichlorophenoxy)propanoic acid |
|
Potential groundwater contaminant |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless crystals |
|
|
|
|
|
- Headland Agrochemicals
- FBC
- Bayer
- Universal Crop Protection
|
|
- Weedone 170
- Hedonal DP
- Hormatox
- Polyclene
- Seritox
- Polymore
|
|
Often supplied as an emulsifiable concentrate or as an emulsion. |
|
|
|
|
|
350 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderate |
|
689000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Ethyl acetate |
- |
1265000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
3030 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Hexane |
- |
61200 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Toluene |
- |
|
117 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
204 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (open cup) |
- |
|
|
1.95 X 1002 |
Calculated |
- |
|
2.29 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.42 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
Strong acid |
|
0.01 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
8.80 X 10-06 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
10 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Non-persistent |
|
14 |
Y4 Y = Germany's Federal Environment Agency (UBA) (click here ) 4 = Verified data |
Non-persistent |
|
10 |
X3 X = WINPST database (click here ) 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Other sources: DT₅₀ 21-25 days (R3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Stable |
|
- |
|
12 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
- |
- |
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
Mobile |
|
74 |
|
Other sources: 12.0-170 mL g⁻¹ (R3) |
|
|
0.77 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Mobile |
|
41.2 |
|
0.87 |
|
Kf range 0.67-0.86 mL g⁻¹, Kfoc range 34.4-47.9 mL g⁻¹, 1/n range 0.86-0.88, Soils=2 |
|
- |
|
|
|
|
|
2.39 |
Calculated |
Transition state |
|
|
5.07 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
|
6 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
Not available |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
825 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
> 5 |
- |
|
- |
- |
- |
|
504 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
16 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.5 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
1100 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Pseudokirchneriella subcapitata |
Low |
|
180 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
High (class III) |
- |
- |
|
825 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
1400 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
- |
|
0.65 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
Low risk to Europeans as no longer approved for use |
|
Low risk to Europeans as no longer approved for use |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
Non-statutory WHO drinking water guideline 0.1 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
Health: H302, H312, H315, H318 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
dichlorprop |
|
dichlorprop |
|
Dichlorprop |
|
dichlorprop |
|
diclorprop |
|
diclorprop |
|
dichlorprop |
|
dichlorprop |
|
- |
|
dichlorprop |
|
dichloorprop |
|
- |